C21H22O7 — CID 45101493
5,6-dimethoxy-2-(3,4,5-trimethoxybenzoyl)-2,3-dihydroinden-1-one (PubChem CID 45101493) has the molecular formula C21H22O7 and a molecular weight of 386.40 g/mol. Its IUPAC name is 5,6-dimethoxy-2-(3,4,5-trimethoxybenzoyl)-2,3-dihydroinden-1-one.
| Compound Name | 5,6-dimethoxy-2-(3,4,5-trimethoxybenzoyl)-2,3-dihydroinden-1-one |
|---|---|
| PubChem CID | 45101493 |
| Molecular Formula | C21H22O7 |
| Molecular Weight | 386.40 g/mol |
| Exact Mass | 386.14 |
| IUPAC Name | 5,6-dimethoxy-2-(3,4,5-trimethoxybenzoyl)-2,3-dihydroinden-1-one |
| SMILES | COc1cc2c(cc1OC)C(=O)C(C(=O)c1cc(OC)c(OC)c(OC)c1)C2 |
| InChI | InChI=1S/C21H22O7/c1-24-15-7-11-6-14(20(23)13(11)10-16(15)25-2)19(22)12-8-17(26-3)21(28-5)18(9-12)27-4/h7-10,14H,6H2,1-5H3 |
| InChIKey | UQKXCGKVDCHFBT-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.40 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|