C25H34N6O5 — CID 45101519
4-(diaminomethylideneamino)-N-[4-[2-[[2-hydroxy-2-(5-hydroxy-3-oxo-4H-1,4-benzoxazin-8-yl)ethyl]amino]-2-methylpropyl]phenyl]butanamide (PubChem CID 45101519) has the molecular formula C25H34N6O5 and a molecular weight of 498.58 g/mol. Its IUPAC name is 4-(diaminomethylideneamino)-N-[4-[2-[[2-hydroxy-2-(5-hydroxy-3-oxo-4H-1,4-benzoxazin-8-yl)ethyl]amino]-2-methylpropyl]phenyl]butanamide.
| Compound Name | 4-(diaminomethylideneamino)-N-[4-[2-[[2-hydroxy-2-(5-hydroxy-3-oxo-4H-1,4-benzoxazin-8-yl)ethyl]amino]-2-methylpropyl]phenyl]butanamide |
|---|---|
| PubChem CID | 45101519 |
| Molecular Formula | C25H34N6O5 |
| Molecular Weight | 498.58 g/mol |
| Exact Mass | 498.26 |
| IUPAC Name | 4-(diaminomethylideneamino)-N-[4-[2-[[2-hydroxy-2-(5-hydroxy-3-oxo-4H-1,4-benzoxazin-8-yl)ethyl]amino]-2-methylpropyl]phenyl]butanamide |
| SMILES | CC(C)(Cc1ccc(NC(=O)CCCN=C(N)N)cc1)NCC(O)c1ccc(O)c2c1OCC(=O)N2 |
| InChI | InChI=1S/C25H34N6O5/c1-25(2,12-15-5-7-16(8-6-15)30-20(34)4-3-11-28-24(26)27)29-13-19(33)17-9-10-18(32)22-23(17)36-14-21(35)31-22/h5-10,19,29,32-33H,3-4,11-14H2,1-2H3,(H,30,34)(H,31,35)(H4,26,27,28) |
| InChIKey | KRTHJCYGNSJFOY-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 184.32 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.58 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|