C16H26O5 — CID 45101603
ethyl (4S)-4-[(4S,5R)-5-ethenyl-2,2-diethyl-1,3-dioxolan-4-yl]-4-hydroxy-2-methylidenebutanoate (PubChem CID 45101603) has the molecular formula C16H26O5 and a molecular weight of 298.38 g/mol. Its IUPAC name is ethyl (4S)-4-[(4S,5R)-5-ethenyl-2,2-diethyl-1,3-dioxolan-4-yl]-4-hydroxy-2-methylidenebutanoate.
| Compound Name | ethyl (4S)-4-[(4S,5R)-5-ethenyl-2,2-diethyl-1,3-dioxolan-4-yl]-4-hydroxy-2-methylidenebutanoate |
|---|---|
| PubChem CID | 45101603 |
| Molecular Formula | C16H26O5 |
| Molecular Weight | 298.38 g/mol |
| Exact Mass | 298.18 |
| IUPAC Name | ethyl (4S)-4-[(4S,5R)-5-ethenyl-2,2-diethyl-1,3-dioxolan-4-yl]-4-hydroxy-2-methylidenebutanoate |
| SMILES | C=C[C@H]1OC(CC)(CC)O[C@H]1[C@@H](O)CC(=C)C(=O)OCC |
| InChI | InChI=1S/C16H26O5/c1-6-13-14(21-16(7-2,8-3)20-13)12(17)10-11(5)15(18)19-9-4/h6,12-14,17H,1,5,7-10H2,2-4H3/t12-,13+,14-/m0/s1 |
| InChIKey | RXAJJXWERSOKSV-MJBXVCDLSA-N |
| XLogP | 2.34 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.38 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|