C32H44F3NO4Si — CID 45101608
tert-butyl (E,2S,6S)-6-[tert-butyl(diphenyl)silyl]oxy-2-[(2,2,2-trifluoroacetyl)amino]dec-4-enoate (PubChem CID 45101608) has the molecular formula C32H44F3NO4Si and a molecular weight of 591.79 g/mol. Its IUPAC name is tert-butyl (E,2S,6S)-6-[tert-butyl(diphenyl)silyl]oxy-2-[(2,2,2-trifluoroacetyl)amino]dec-4-enoate.
| Compound Name | tert-butyl (E,2S,6S)-6-[tert-butyl(diphenyl)silyl]oxy-2-[(2,2,2-trifluoroacetyl)amino]dec-4-enoate |
|---|---|
| PubChem CID | 45101608 |
| Molecular Formula | C32H44F3NO4Si |
| Molecular Weight | 591.79 g/mol |
| Exact Mass | 591.30 |
| IUPAC Name | tert-butyl (E,2S,6S)-6-[tert-butyl(diphenyl)silyl]oxy-2-[(2,2,2-trifluoroacetyl)amino]dec-4-enoate |
| SMILES | CCCC[C@@H](/C=C/C[C@H](NC(=O)C(F)(F)F)C(=O)OC(C)(C)C)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C32H44F3NO4Si/c1-8-9-17-24(18-16-23-27(28(37)39-30(2,3)4)36-29(38)32(33,34)35)40-41(31(5,6)7,25-19-12-10-13-20-25)26-21-14-11-15-22-26/h10-16,18-22,24,27H,8-9,17,23H2,1-7H3,(H,36,38)/b18-16+/t24-,27-/m0/s1 |
| InChIKey | RWBDOMPQUWMXKF-CZPKIJFNSA-N |
| XLogP | 6.46 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.79 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|