C22H42O2Si — CID 45101636
tert-butyl-[[(1S,2S,6S)-2-[(E)-3-methoxyprop-2-enyl]-1,6-dimethyl-3-propan-2-ylidenecyclohexyl]methoxy]-dimethylsilane (PubChem CID 45101636) has the molecular formula C22H42O2Si and a molecular weight of 366.66 g/mol. Its IUPAC name is tert-butyl-[[(1S,2S,6S)-2-[(E)-3-methoxyprop-2-enyl]-1,6-dimethyl-3-propan-2-ylidenecyclohexyl]methoxy]-dimethylsilane.
| Compound Name | tert-butyl-[[(1S,2S,6S)-2-[(E)-3-methoxyprop-2-enyl]-1,6-dimethyl-3-propan-2-ylidenecyclohexyl]methoxy]-dimethylsilane |
|---|---|
| PubChem CID | 45101636 |
| Molecular Formula | C22H42O2Si |
| Molecular Weight | 366.66 g/mol |
| Exact Mass | 366.30 |
| IUPAC Name | tert-butyl-[[(1S,2S,6S)-2-[(E)-3-methoxyprop-2-enyl]-1,6-dimethyl-3-propan-2-ylidenecyclohexyl]methoxy]-dimethylsilane |
| SMILES | CO/C=C/C[C@H]1C(=C(C)C)CC[C@H](C)[C@]1(C)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H42O2Si/c1-17(2)19-14-13-18(3)22(7,20(19)12-11-15-23-8)16-24-25(9,10)21(4,5)6/h11,15,18,20H,12-14,16H2,1-10H3/b15-11+/t18-,20-,22-/m0/s1 |
| InChIKey | MMZXGFAGBIROJG-XEHMEICKSA-N |
| XLogP | 6.95 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.66 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|