C13H20BrNO — CID 45101642
1-[(7R,8aR)-5-(bromomethyl)-7-methyl-3,4,6,7,8,8a-hexahydro-2H-quinolin-1-yl]ethanone (PubChem CID 45101642) has the molecular formula C13H20BrNO and a molecular weight of 286.21 g/mol. Its IUPAC name is 1-[(7R,8aR)-5-(bromomethyl)-7-methyl-3,4,6,7,8,8a-hexahydro-2H-quinolin-1-yl]ethanone.
| Compound Name | 1-[(7R,8aR)-5-(bromomethyl)-7-methyl-3,4,6,7,8,8a-hexahydro-2H-quinolin-1-yl]ethanone |
|---|---|
| PubChem CID | 45101642 |
| Molecular Formula | C13H20BrNO |
| Molecular Weight | 286.21 g/mol |
| Exact Mass | 285.07 |
| IUPAC Name | 1-[(7R,8aR)-5-(bromomethyl)-7-methyl-3,4,6,7,8,8a-hexahydro-2H-quinolin-1-yl]ethanone |
| SMILES | CC(=O)N1CCCC2=C(CBr)C[C@@H](C)C[C@H]21 |
| InChI | InChI=1S/C13H20BrNO/c1-9-6-11(8-14)12-4-3-5-15(10(2)16)13(12)7-9/h9,13H,3-8H2,1-2H3/t9-,13-/m1/s1 |
| InChIKey | OAYZBCWGYDBJDF-NOZJJQNGSA-N |
| XLogP | 3.12 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.21 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|