C19H25F4N3O2 — CID 45101722
N-[[(2S)-1-[(3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoyl]pyrrolidin-2-yl]methyl]-2-fluoro-2-methylpropanamide (PubChem CID 45101722) has the molecular formula C19H25F4N3O2 and a molecular weight of 403.42 g/mol. Its IUPAC name is N-[[(2S)-1-[(3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoyl]pyrrolidin-2-yl]methyl]-2-fluoro-2-methylpropanamide.
| Compound Name | N-[[(2S)-1-[(3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoyl]pyrrolidin-2-yl]methyl]-2-fluoro-2-methylpropanamide |
|---|---|
| PubChem CID | 45101722 |
| Molecular Formula | C19H25F4N3O2 |
| Molecular Weight | 403.42 g/mol |
| Exact Mass | 403.19 |
| IUPAC Name | N-[[(2S)-1-[(3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoyl]pyrrolidin-2-yl]methyl]-2-fluoro-2-methylpropanamide |
| SMILES | CC(C)(F)C(=O)NC[C@@H]1CCCN1C(=O)C[C@H](N)Cc1cc(F)c(F)cc1F |
| InChI | InChI=1S/C19H25F4N3O2/c1-19(2,23)18(28)25-10-13-4-3-5-26(13)17(27)8-12(24)6-11-7-15(21)16(22)9-14(11)20/h7,9,12-13H,3-6,8,10,24H2,1-2H3,(H,25,28)/t12-,13+/m1/s1 |
| InChIKey | FDTLYCFADICLAZ-OLZOCXBDSA-N |
| XLogP | 2.22 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.42 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|