C21H18F5N5O2 — CID 45101723
(3R)-3-amino-1-[(2S)-2-[3-(3,5-difluoro-2-pyridinyl)-1,2,4-oxadiazol-5-yl]pyrrolidin-1-yl]-4-(2,4,5-trifluorophenyl)butan-1-one (PubChem CID 45101723) has the molecular formula C21H18F5N5O2 and a molecular weight of 467.40 g/mol. Its IUPAC name is (3R)-3-amino-1-[(2S)-2-[3-(3,5-difluoro-2-pyridinyl)-1,2,4-oxadiazol-5-yl]pyrrolidin-1-yl]-4-(2,4,5-trifluorophenyl)butan-1-one.
| Compound Name | (3R)-3-amino-1-[(2S)-2-[3-(3,5-difluoro-2-pyridinyl)-1,2,4-oxadiazol-5-yl]pyrrolidin-1-yl]-4-(2,4,5-trifluorophenyl)butan-1-one |
|---|---|
| PubChem CID | 45101723 |
| Molecular Formula | C21H18F5N5O2 |
| Molecular Weight | 467.40 g/mol |
| Exact Mass | 467.14 |
| IUPAC Name | (3R)-3-amino-1-[(2S)-2-[3-(3,5-difluoro-2-pyridinyl)-1,2,4-oxadiazol-5-yl]pyrrolidin-1-yl]-4-(2,4,5-trifluorophenyl)butan-1-one |
| SMILES | N[C@@H](CC(=O)N1CCC[C@H]1c1nc(-c2ncc(F)cc2F)no1)Cc1cc(F)c(F)cc1F |
| InChI | InChI=1S/C21H18F5N5O2/c22-11-6-16(26)19(28-9-11)20-29-21(33-30-20)17-2-1-3-31(17)18(32)7-12(27)4-10-5-14(24)15(25)8-13(10)23/h5-6,8-9,12,17H,1-4,7,27H2/t12-,17+/m1/s1 |
| InChIKey | ZANLSOZQTSYTOA-PXAZEXFGSA-N |
| XLogP | 3.45 |
| TPSA | 98.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.40 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|