C34H42O18S4 — CID 45101961
[(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-[[3-[[(2S,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]disulfanyl]phenyl]disulfanyl]oxan-2-yl]methyl acetate (PubChem CID 45101961) has the molecular formula C34H42O18S4 and a molecular weight of 866.96 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-[[3-[[(2S,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]disulfanyl]phenyl]disulfanyl]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-[[3-[[(2S,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]disulfanyl]phenyl]disulfanyl]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 45101961 |
| Molecular Formula | C34H42O18S4 |
| Molecular Weight | 866.96 g/mol |
| Exact Mass | 866.13 |
| IUPAC Name | [(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-[[3-[[(2S,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]disulfanyl]phenyl]disulfanyl]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](SSc2cccc(SS[C@@H]3O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]3OC(C)=O)c2)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C34H42O18S4/c1-15(35)43-13-25-27(45-17(3)37)29(47-19(5)39)31(49-21(7)41)33(51-25)55-53-23-10-9-11-24(12-23)54-56-34-32(50-22(8)42)30(48-20(6)40)28(46-18(4)38)26(52-34)14-44-16(2)36/h9-12,25-34H,13-14H2,1-8H3/t25-,26-,27-,28-,29+,30+,31-,32-,33+,34+/m1/s1 |
| InChIKey | YFJCGFDSRZVGFR-CPDYKFRISA-N |
| XLogP | 3.33 |
| TPSA | 228.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 22 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 866.96 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 22 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|