About 3-(4-benzyl-3,6-dihydro-2H-pyridin-1-yl)-1-(5-chloro-6-methoxynaphthalen-2-yl)propan-1-ol
3-(4-benzyl-3,6-dihydro-2H-pyridin-1-yl)-1-(5-chloro-6-methoxynaphthalen-2-yl)propan-1-ol (PubChem CID 45102009) has the molecular formula C26H28ClNO2
and a molecular weight of 421.97 g/mol. Its IUPAC name is 3-(4-benzyl-3,6-dihydro-2H-pyridin-1-yl)-1-(5-chloro-6-methoxynaphthalen-2-yl)propan-1-ol.
Molecular Properties
| Compound Name | 3-(4-benzyl-3,6-dihydro-2H-pyridin-1-yl)-1-(5-chloro-6-methoxynaphthalen-2-yl)propan-1-ol |
| PubChem CID | 45102009 |
| Molecular Formula | C26H28ClNO2 |
| Molecular Weight | 421.97 g/mol |
| Exact Mass | 421.18 |
| IUPAC Name | 3-(4-benzyl-3,6-dihydro-2H-pyridin-1-yl)-1-(5-chloro-6-methoxynaphthalen-2-yl)propan-1-ol |
| SMILES | COc1ccc2cc(C(O)CCN3CC=C(Cc4ccccc4)CC3)ccc2c1Cl |
| InChI | InChI=1S/C26H28ClNO2/c1-30-25-10-8-21-18-22(7-9-23(21)26(25)27)24(29)13-16-28-14-11-20(12-15-28)17-19-5-3-2-4-6-19/h2-11,18,24,29H,12-17H2,1H3 |
| InChIKey | JYIMWQCCVNSNJW-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 421.97 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-(4-benzyl-3,6-dihydro-2H-pyridin-1-yl)-1-(5-chloro-6-methoxynaphthalen-2-yl)propan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-benzyl-3,6-dihydro-2H-pyridin-1-yl)-1-(5-chloro-6-methoxynaphthalen-2-yl)propan-1-ol?
The IUPAC name of 3-(4-benzyl-3,6-dihydro-2H-pyridin-1-yl)-1-(5-chloro-6-methoxynaphthalen-2-yl)propan-1-ol (CID 45102009) is 3-(4-benzyl-3,6-dihydro-2H-pyridin-1-yl)-1-(5-chloro-6-methoxynaphthalen-2-yl)propan-1-ol.
What is the SMILES notation for 3-(4-benzyl-3,6-dihydro-2H-pyridin-1-yl)-1-(5-chloro-6-methoxynaphthalen-2-yl)propan-1-ol?
The canonical SMILES for 3-(4-benzyl-3,6-dihydro-2H-pyridin-1-yl)-1-(5-chloro-6-methoxynaphthalen-2-yl)propan-1-ol is COc1ccc2cc(C(O)CCN3CC=C(Cc4ccccc4)CC3)ccc2c1Cl.
What is the InChIKey of 3-(4-benzyl-3,6-dihydro-2H-pyridin-1-yl)-1-(5-chloro-6-methoxynaphthalen-2-yl)propan-1-ol?
The InChIKey is JYIMWQCCVNSNJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H28ClNO2/c1-30-25-10-8-21-18-22(7-9-23(21)26(25)27)24(29)13-16-28-14-11-20(12-15-28)17-19-5-3-2-4-6-19/h2-11,18,24,29H,12-17H2,1H3.
What are the key properties of 3-(4-benzyl-3,6-dihydro-2H-pyridin-1-yl)-1-(5-chloro-6-methoxynaphthalen-2-yl)propan-1-ol?
3-(4-benzyl-3,6-dihydro-2H-pyridin-1-yl)-1-(5-chloro-6-methoxynaphthalen-2-yl)propan-1-ol has a molecular weight of 421.97 g/mol, XLogP of 5.80, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-benzyl-3,6-dihydro-2H-pyridin-1-yl)-1-(5-chloro-6-methoxynaphthalen-2-yl)propan-1-ol is sourced from PubChem (CID 45102009), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).