C30H38N2O6 — CID 45102042
4-amino-N-[(2R,3R,4R,5S,6R)-5-hydroxy-6-(methoxymethyl)-4-(naphthalen-2-ylmethoxy)-2-(2-phenylethoxy)oxan-3-yl]butanamide (PubChem CID 45102042) has the molecular formula C30H38N2O6 and a molecular weight of 522.64 g/mol. Its IUPAC name is 4-amino-N-[(2R,3R,4R,5S,6R)-5-hydroxy-6-(methoxymethyl)-4-(naphthalen-2-ylmethoxy)-2-(2-phenylethoxy)oxan-3-yl]butanamide.
| Compound Name | 4-amino-N-[(2R,3R,4R,5S,6R)-5-hydroxy-6-(methoxymethyl)-4-(naphthalen-2-ylmethoxy)-2-(2-phenylethoxy)oxan-3-yl]butanamide |
|---|---|
| PubChem CID | 45102042 |
| Molecular Formula | C30H38N2O6 |
| Molecular Weight | 522.64 g/mol |
| Exact Mass | 522.27 |
| IUPAC Name | 4-amino-N-[(2R,3R,4R,5S,6R)-5-hydroxy-6-(methoxymethyl)-4-(naphthalen-2-ylmethoxy)-2-(2-phenylethoxy)oxan-3-yl]butanamide |
| SMILES | COC[C@H]1O[C@@H](OCCc2ccccc2)[C@H](NC(=O)CCCN)[C@@H](OCc2ccc3ccccc3c2)[C@@H]1O |
| InChI | InChI=1S/C30H38N2O6/c1-35-20-25-28(34)29(37-19-22-13-14-23-10-5-6-11-24(23)18-22)27(32-26(33)12-7-16-31)30(38-25)36-17-15-21-8-3-2-4-9-21/h2-6,8-11,13-14,18,25,27-30,34H,7,12,15-17,19-20,31H2,1H3,(H,32,33)/t25-,27-,28-,29-,30-/m1/s1 |
| InChIKey | GAGMNMVDVIUYOH-VDFIJDOYSA-N |
| XLogP | 2.94 |
| TPSA | 112.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.64 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |