C16H20O2 — CID 45102252
(1S,2R,3R,4S,5R,7S)-4-(3-hydroxyphenyl)adamantan-2-ol (PubChem CID 45102252) has the molecular formula C16H20O2 and a molecular weight of 244.33 g/mol. Its IUPAC name is (1S,2R,3R,4S,5R,7S)-4-(3-hydroxyphenyl)adamantan-2-ol.
| Compound Name | (1S,2R,3R,4S,5R,7S)-4-(3-hydroxyphenyl)adamantan-2-ol |
|---|---|
| PubChem CID | 45102252 |
| Molecular Formula | C16H20O2 |
| Molecular Weight | 244.33 g/mol |
| Exact Mass | 244.15 |
| IUPAC Name | (1S,2R,3R,4S,5R,7S)-4-(3-hydroxyphenyl)adamantan-2-ol |
| SMILES | Oc1cccc([C@H]2[C@@H]3C[C@H]4C[C@@H](C3)[C@@H](O)[C@@H]2C4)c1 |
| InChI | InChI=1S/C16H20O2/c17-13-3-1-2-10(8-13)15-11-4-9-5-12(7-11)16(18)14(15)6-9/h1-3,8-9,11-12,14-18H,4-7H2/t9-,11+,12-,14+,15-,16+/m0/s1 |
| InChIKey | YZMXUUYMZVIXEQ-HTRZWEOCSA-N |
| XLogP | 2.90 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.33 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |