C20H31NO5Si — CID 45103068
(2S,3R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-3-methyl-1-phenylmethoxycarbonylpyrrolidine-2-carboxylic acid (PubChem CID 45103068) has the molecular formula C20H31NO5Si and a molecular weight of 393.56 g/mol. Its IUPAC name is (2S,3R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-3-methyl-1-phenylmethoxycarbonylpyrrolidine-2-carboxylic acid.
| Compound Name | (2S,3R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-3-methyl-1-phenylmethoxycarbonylpyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 45103068 |
| Molecular Formula | C20H31NO5Si |
| Molecular Weight | 393.56 g/mol |
| Exact Mass | 393.20 |
| IUPAC Name | (2S,3R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-3-methyl-1-phenylmethoxycarbonylpyrrolidine-2-carboxylic acid |
| SMILES | C[C@H]1[C@@H](O[Si](C)(C)C(C)(C)C)CN(C(=O)OCc2ccccc2)[C@@H]1C(=O)O |
| InChI | InChI=1S/C20H31NO5Si/c1-14-16(26-27(5,6)20(2,3)4)12-21(17(14)18(22)23)19(24)25-13-15-10-8-7-9-11-15/h7-11,14,16-17H,12-13H2,1-6H3,(H,22,23)/t14-,16-,17-/m0/s1 |
| InChIKey | XJZRQQYRJLRTPN-XIRDDKMYSA-N |
| XLogP | 4.12 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.56 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|