About tert-butyl N-[benzenesulfonyl-[4-(trifluoromethyl)phenyl]methyl]carbamate
tert-butyl N-[benzenesulfonyl-[4-(trifluoromethyl)phenyl]methyl]carbamate (PubChem CID 45103093) has the molecular formula C19H20F3NO4S
and a molecular weight of 415.43 g/mol. Its IUPAC name is tert-butyl N-[benzenesulfonyl-[4-(trifluoromethyl)phenyl]methyl]carbamate.
Molecular Properties
| Compound Name | tert-butyl N-[benzenesulfonyl-[4-(trifluoromethyl)phenyl]methyl]carbamate |
| PubChem CID | 45103093 |
| Molecular Formula | C19H20F3NO4S |
| Molecular Weight | 415.43 g/mol |
| Exact Mass | 415.11 |
| IUPAC Name | tert-butyl N-[benzenesulfonyl-[4-(trifluoromethyl)phenyl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC(c1ccc(C(F)(F)F)cc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C19H20F3NO4S/c1-18(2,3)27-17(24)23-16(28(25,26)15-7-5-4-6-8-15)13-9-11-14(12-10-13)19(20,21)22/h4-12,16H,1-3H3,(H,23,24) |
| InChIKey | GQGAWFNUFLHUAA-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 415.43 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze tert-butyl N-[benzenesulfonyl-[4-(trifluoromethyl)phenyl]methyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-[benzenesulfonyl-[4-(trifluoromethyl)phenyl]methyl]carbamate?
The IUPAC name of tert-butyl N-[benzenesulfonyl-[4-(trifluoromethyl)phenyl]methyl]carbamate (CID 45103093) is tert-butyl N-[benzenesulfonyl-[4-(trifluoromethyl)phenyl]methyl]carbamate.
What is the SMILES notation for tert-butyl N-[benzenesulfonyl-[4-(trifluoromethyl)phenyl]methyl]carbamate?
The canonical SMILES for tert-butyl N-[benzenesulfonyl-[4-(trifluoromethyl)phenyl]methyl]carbamate is CC(C)(C)OC(=O)NC(c1ccc(C(F)(F)F)cc1)S(=O)(=O)c1ccccc1.
What is the InChIKey of tert-butyl N-[benzenesulfonyl-[4-(trifluoromethyl)phenyl]methyl]carbamate?
The InChIKey is GQGAWFNUFLHUAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20F3NO4S/c1-18(2,3)27-17(24)23-16(28(25,26)15-7-5-4-6-8-15)13-9-11-14(12-10-13)19(20,21)22/h4-12,16H,1-3H3,(H,23,24).
What are the key properties of tert-butyl N-[benzenesulfonyl-[4-(trifluoromethyl)phenyl]methyl]carbamate?
tert-butyl N-[benzenesulfonyl-[4-(trifluoromethyl)phenyl]methyl]carbamate has a molecular weight of 415.43 g/mol, XLogP of 4.70, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[benzenesulfonyl-[4-(trifluoromethyl)phenyl]methyl]carbamate is sourced from PubChem (CID 45103093), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).