C16H21NO3 — CID 45103420
(3S,7aR)-7a-[(1R)-1-hydroxy-2-methylpropyl]-3-phenyl-1,3,6,7-tetrahydropyrrolo[1,2-c][1,3]oxazol-5-one (PubChem CID 45103420) has the molecular formula C16H21NO3 and a molecular weight of 275.35 g/mol. Its IUPAC name is (3S,7aR)-7a-[(1R)-1-hydroxy-2-methylpropyl]-3-phenyl-1,3,6,7-tetrahydropyrrolo[1,2-c][1,3]oxazol-5-one.
| Compound Name | (3S,7aR)-7a-[(1R)-1-hydroxy-2-methylpropyl]-3-phenyl-1,3,6,7-tetrahydropyrrolo[1,2-c][1,3]oxazol-5-one |
|---|---|
| PubChem CID | 45103420 |
| Molecular Formula | C16H21NO3 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.15 |
| IUPAC Name | (3S,7aR)-7a-[(1R)-1-hydroxy-2-methylpropyl]-3-phenyl-1,3,6,7-tetrahydropyrrolo[1,2-c][1,3]oxazol-5-one |
| SMILES | CC(C)[C@@H](O)[C@]12CCC(=O)N1[C@H](c1ccccc1)OC2 |
| InChI | InChI=1S/C16H21NO3/c1-11(2)14(19)16-9-8-13(18)17(16)15(20-10-16)12-6-4-3-5-7-12/h3-7,11,14-15,19H,8-10H2,1-2H3/t14-,15+,16-/m1/s1 |
| InChIKey | WPPODMVYQXTCOO-OWCLPIDISA-N |
| XLogP | 2.09 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |