C18H20F2N8O3 — CID 45103523
2-[6-cyano-3-[(2,2-difluoro-2-phenylethyl)amino]-2-oxopyrazin-1-yl]-N-[2-(diaminomethylideneamino)oxyethyl]acetamide (PubChem CID 45103523) has the molecular formula C18H20F2N8O3 and a molecular weight of 434.41 g/mol. Its IUPAC name is 2-[6-cyano-3-[(2,2-difluoro-2-phenylethyl)amino]-2-oxopyrazin-1-yl]-N-[2-(diaminomethylideneamino)oxyethyl]acetamide.
| Compound Name | 2-[6-cyano-3-[(2,2-difluoro-2-phenylethyl)amino]-2-oxopyrazin-1-yl]-N-[2-(diaminomethylideneamino)oxyethyl]acetamide |
|---|---|
| PubChem CID | 45103523 |
| Molecular Formula | C18H20F2N8O3 |
| Molecular Weight | 434.41 g/mol |
| Exact Mass | 434.16 |
| IUPAC Name | 2-[6-cyano-3-[(2,2-difluoro-2-phenylethyl)amino]-2-oxopyrazin-1-yl]-N-[2-(diaminomethylideneamino)oxyethyl]acetamide |
| SMILES | N#Cc1cnc(NCC(F)(F)c2ccccc2)c(=O)n1CC(=O)NCCON=C(N)N |
| InChI | InChI=1S/C18H20F2N8O3/c19-18(20,12-4-2-1-3-5-12)11-26-15-16(30)28(13(8-21)9-25-15)10-14(29)24-6-7-31-27-17(22)23/h1-5,9H,6-7,10-11H2,(H,24,29)(H,25,26)(H4,22,23,27) |
| InChIKey | NIKUFUKVJGORCK-UHFFFAOYSA-N |
| XLogP | -0.36 |
| TPSA | 173.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.41 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|