C10H13FN2O3S — CID 45103613
4-(2-fluoroethyl)-7-methoxy-2,3-dihydro-1λ6,2,4-benzothiadiazine 1,1-dioxide (PubChem CID 45103613) has the molecular formula C10H13FN2O3S and a molecular weight of 260.29 g/mol. Its IUPAC name is 4-(2-fluoroethyl)-7-methoxy-2,3-dihydro-1λ6,2,4-benzothiadiazine 1,1-dioxide.
| Compound Name | 4-(2-fluoroethyl)-7-methoxy-2,3-dihydro-1λ6,2,4-benzothiadiazine 1,1-dioxide |
|---|---|
| PubChem CID | 45103613 |
| Molecular Formula | C10H13FN2O3S |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.06 |
| IUPAC Name | 4-(2-fluoroethyl)-7-methoxy-2,3-dihydro-1λ6,2,4-benzothiadiazine 1,1-dioxide |
| SMILES | COc1ccc2c(c1)S(=O)(=O)NCN2CCF |
| InChI | InChI=1S/C10H13FN2O3S/c1-16-8-2-3-9-10(6-8)17(14,15)12-7-13(9)5-4-11/h2-3,6,12H,4-5,7H2,1H3 |
| InChIKey | KWCDCFICSOKFNO-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|