C17H20ClF2N7O3 — CID 45103723
2-[6-chloro-3-[(2,2-difluoro-2-phenylethyl)amino]-2-oxopyrazin-1-yl]-N-[2-(diaminomethylideneamino)oxyethyl]acetamide (PubChem CID 45103723) has the molecular formula C17H20ClF2N7O3 and a molecular weight of 443.84 g/mol. Its IUPAC name is 2-[6-chloro-3-[(2,2-difluoro-2-phenylethyl)amino]-2-oxopyrazin-1-yl]-N-[2-(diaminomethylideneamino)oxyethyl]acetamide.
| Compound Name | 2-[6-chloro-3-[(2,2-difluoro-2-phenylethyl)amino]-2-oxopyrazin-1-yl]-N-[2-(diaminomethylideneamino)oxyethyl]acetamide |
|---|---|
| PubChem CID | 45103723 |
| Molecular Formula | C17H20ClF2N7O3 |
| Molecular Weight | 443.84 g/mol |
| Exact Mass | 443.13 |
| IUPAC Name | 2-[6-chloro-3-[(2,2-difluoro-2-phenylethyl)amino]-2-oxopyrazin-1-yl]-N-[2-(diaminomethylideneamino)oxyethyl]acetamide |
| SMILES | NC(N)=NOCCNC(=O)Cn1c(Cl)cnc(NCC(F)(F)c2ccccc2)c1=O |
| InChI | InChI=1S/C17H20ClF2N7O3/c18-12-8-24-14(25-10-17(19,20)11-4-2-1-3-5-11)15(29)27(12)9-13(28)23-6-7-30-26-16(21)22/h1-5,8H,6-7,9-10H2,(H,23,28)(H,24,25)(H4,21,22,26) |
| InChIKey | VZFNTNJRDFGPHL-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 149.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.84 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|