C28H39N5O2S — CID 45103773
(3S,4aS,8aS)-2-[(2R,3S)-3-azido-2-hydroxy-4-(4-phenylthiophen-2-yl)butyl]-N-tert-butyl-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline-3-carboxamide (PubChem CID 45103773) has the molecular formula C28H39N5O2S and a molecular weight of 509.72 g/mol. Its IUPAC name is (3S,4aS,8aS)-2-[(2R,3S)-3-azido-2-hydroxy-4-(4-phenylthiophen-2-yl)butyl]-N-tert-butyl-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline-3-carboxamide.
| Compound Name | (3S,4aS,8aS)-2-[(2R,3S)-3-azido-2-hydroxy-4-(4-phenylthiophen-2-yl)butyl]-N-tert-butyl-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline-3-carboxamide |
|---|---|
| PubChem CID | 45103773 |
| Molecular Formula | C28H39N5O2S |
| Molecular Weight | 509.72 g/mol |
| Exact Mass | 509.28 |
| IUPAC Name | (3S,4aS,8aS)-2-[(2R,3S)-3-azido-2-hydroxy-4-(4-phenylthiophen-2-yl)butyl]-N-tert-butyl-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline-3-carboxamide |
| SMILES | CC(C)(C)NC(=O)[C@@H]1C[C@@H]2CCCC[C@@H]2CN1C[C@@H](O)[C@H](Cc1cc(-c2ccccc2)cs1)N=[N+]=[N-] |
| InChI | InChI=1S/C28H39N5O2S/c1-28(2,3)30-27(35)25-14-20-11-7-8-12-21(20)16-33(25)17-26(34)24(31-32-29)15-23-13-22(18-36-23)19-9-5-4-6-10-19/h4-6,9-10,13,18,20-21,24-26,34H,7-8,11-12,14-17H2,1-3H3,(H,30,35)/t20-,21+,24-,25-,26+/m0/s1 |
| InChIKey | CZQPMXOWCLLNBJ-UHUXJTDZSA-N |
| XLogP | 5.79 |
| TPSA | 101.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.72 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|