About dibenzyl [6-(2-fluorophenyl)-[1,3]dioxolo[4,5-g]quinolin-8-yl] phosphate
dibenzyl [6-(2-fluorophenyl)-[1,3]dioxolo[4,5-g]quinolin-8-yl] phosphate (PubChem CID 45104205) has the molecular formula C30H23FNO6P
and a molecular weight of 543.49 g/mol. Its IUPAC name is dibenzyl [6-(2-fluorophenyl)-[1,3]dioxolo[4,5-g]quinolin-8-yl] phosphate.
Molecular Properties
| Compound Name | dibenzyl [6-(2-fluorophenyl)-[1,3]dioxolo[4,5-g]quinolin-8-yl] phosphate |
| PubChem CID | 45104205 |
| Molecular Formula | C30H23FNO6P |
| Molecular Weight | 543.49 g/mol |
| Exact Mass | 543.12 |
| IUPAC Name | dibenzyl [6-(2-fluorophenyl)-[1,3]dioxolo[4,5-g]quinolin-8-yl] phosphate |
| SMILES | O=P(OCc1ccccc1)(OCc1ccccc1)Oc1cc(-c2ccccc2F)nc2cc3c(cc12)OCO3 |
| InChI | InChI=1S/C30H23FNO6P/c31-25-14-8-7-13-23(25)26-16-28(24-15-29-30(35-20-34-29)17-27(24)32-26)38-39(33,36-18-21-9-3-1-4-10-21)37-19-22-11-5-2-6-12-22/h1-17H,18-20H2 |
| InChIKey | CWTLCGVZBPTMDN-UHFFFAOYSA-N |
| XLogP | 7.69 |
| TPSA | 76.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 543.49 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze dibenzyl [6-(2-fluorophenyl)-[1,3]dioxolo[4,5-g]quinolin-8-yl] phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dibenzyl [6-(2-fluorophenyl)-[1,3]dioxolo[4,5-g]quinolin-8-yl] phosphate?
The IUPAC name of dibenzyl [6-(2-fluorophenyl)-[1,3]dioxolo[4,5-g]quinolin-8-yl] phosphate (CID 45104205) is dibenzyl [6-(2-fluorophenyl)-[1,3]dioxolo[4,5-g]quinolin-8-yl] phosphate.
What is the SMILES notation for dibenzyl [6-(2-fluorophenyl)-[1,3]dioxolo[4,5-g]quinolin-8-yl] phosphate?
The canonical SMILES for dibenzyl [6-(2-fluorophenyl)-[1,3]dioxolo[4,5-g]quinolin-8-yl] phosphate is O=P(OCc1ccccc1)(OCc1ccccc1)Oc1cc(-c2ccccc2F)nc2cc3c(cc12)OCO3.
What is the InChIKey of dibenzyl [6-(2-fluorophenyl)-[1,3]dioxolo[4,5-g]quinolin-8-yl] phosphate?
The InChIKey is CWTLCGVZBPTMDN-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H23FNO6P/c31-25-14-8-7-13-23(25)26-16-28(24-15-29-30(35-20-34-29)17-27(24)32-26)38-39(33,36-18-21-9-3-1-4-10-21)37-19-22-11-5-2-6-12-22/h1-17H,18-20H2.
What are the key properties of dibenzyl [6-(2-fluorophenyl)-[1,3]dioxolo[4,5-g]quinolin-8-yl] phosphate?
dibenzyl [6-(2-fluorophenyl)-[1,3]dioxolo[4,5-g]quinolin-8-yl] phosphate has a molecular weight of 543.49 g/mol, XLogP of 7.69, 9 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for dibenzyl [6-(2-fluorophenyl)-[1,3]dioxolo[4,5-g]quinolin-8-yl] phosphate is sourced from PubChem (CID 45104205), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).