C29H31F4N5O2 — CID 45104217
3-[4-[(2S)-4-methyl-2-(quinolin-6-ylmethylamino)pentan-2-yl]triazol-1-yl]-1-(2,3,5,6-tetrafluorophenoxy)pentan-2-one (PubChem CID 45104217) has the molecular formula C29H31F4N5O2 and a molecular weight of 557.59 g/mol. Its IUPAC name is 3-[4-[(2S)-4-methyl-2-(quinolin-6-ylmethylamino)pentan-2-yl]triazol-1-yl]-1-(2,3,5,6-tetrafluorophenoxy)pentan-2-one.
| Compound Name | 3-[4-[(2S)-4-methyl-2-(quinolin-6-ylmethylamino)pentan-2-yl]triazol-1-yl]-1-(2,3,5,6-tetrafluorophenoxy)pentan-2-one |
|---|---|
| PubChem CID | 45104217 |
| Molecular Formula | C29H31F4N5O2 |
| Molecular Weight | 557.59 g/mol |
| Exact Mass | 557.24 |
| IUPAC Name | 3-[4-[(2S)-4-methyl-2-(quinolin-6-ylmethylamino)pentan-2-yl]triazol-1-yl]-1-(2,3,5,6-tetrafluorophenoxy)pentan-2-one |
| SMILES | CCC(C(=O)COc1c(F)c(F)cc(F)c1F)n1cc([C@](C)(CC(C)C)NCc2ccc3ncccc3c2)nn1 |
| InChI | InChI=1S/C29H31F4N5O2/c1-5-23(24(39)16-40-28-26(32)20(30)12-21(31)27(28)33)38-15-25(36-37-38)29(4,13-17(2)3)35-14-18-8-9-22-19(11-18)7-6-10-34-22/h6-12,15,17,23,35H,5,13-14,16H2,1-4H3/t23?,29-/m0/s1 |
| InChIKey | BJXIWHVMUJFWQV-IZCXSWDTSA-N |
| XLogP | 6.03 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.59 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|