C18H22N2 — CID 45104223
(3S)-3,5-dimethyl-N-(quinolin-6-ylmethyl)hex-1-yn-3-amine (PubChem CID 45104223) has the molecular formula C18H22N2 and a molecular weight of 266.39 g/mol. Its IUPAC name is (3S)-3,5-dimethyl-N-(quinolin-6-ylmethyl)hex-1-yn-3-amine.
| Compound Name | (3S)-3,5-dimethyl-N-(quinolin-6-ylmethyl)hex-1-yn-3-amine |
|---|---|
| PubChem CID | 45104223 |
| Molecular Formula | C18H22N2 |
| Molecular Weight | 266.39 g/mol |
| Exact Mass | 266.18 |
| IUPAC Name | (3S)-3,5-dimethyl-N-(quinolin-6-ylmethyl)hex-1-yn-3-amine |
| SMILES | C#C[C@](C)(CC(C)C)NCc1ccc2ncccc2c1 |
| InChI | InChI=1S/C18H22N2/c1-5-18(4,12-14(2)3)20-13-15-8-9-17-16(11-15)7-6-10-19-17/h1,6-11,14,20H,12-13H2,2-4H3/t18-/m1/s1 |
| InChIKey | JUIHTUDEPLHLQX-GOSISDBHSA-N |
| XLogP | 3.76 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.39 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|