ethyl 5,6-dimethoxy-1-benzothiophene-2-carboxylate

C13H14O4S — CID 45104330

IUPACethyl 5,6-dimethoxy-1-benzothiophene-2-carboxylate
SMILESCCOC(=O)c1cc2cc(OC)c(OC)cc2s1
InChIInChI=1S/C13H14O4S/c1-4-17-13(14)12-6-8-5-9(15-2)10(16-3)7-11(8)18-12/h5-7H,4H2,1-3H3
InChIKeyXIYUVNDNLSBEKN-UHFFFAOYSA-N
MW266.32 g/mol
LogP3.10
Rot. Bonds4

About ethyl 5,6-dimethoxy-1-benzothiophene-2-carboxylate

ethyl 5,6-dimethoxy-1-benzothiophene-2-carboxylate (PubChem CID 45104330) has the molecular formula C13H14O4S and a molecular weight of 266.32 g/mol. Its IUPAC name is ethyl 5,6-dimethoxy-1-benzothiophene-2-carboxylate.

Molecular Properties

Compound Nameethyl 5,6-dimethoxy-1-benzothiophene-2-carboxylate
PubChem CID45104330
Molecular FormulaC13H14O4S
Molecular Weight266.32 g/mol
Exact Mass266.06
IUPAC Nameethyl 5,6-dimethoxy-1-benzothiophene-2-carboxylate
SMILESCCOC(=O)c1cc2cc(OC)c(OC)cc2s1
InChIInChI=1S/C13H14O4S/c1-4-17-13(14)12-6-8-5-9(15-2)10(16-3)7-11(8)18-12/h5-7H,4H2,1-3H3
InChIKeyXIYUVNDNLSBEKN-UHFFFAOYSA-N
XLogP3.10
TPSA44.76 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds4
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500266.32
LogP ≤ 53.10
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Analyze ethyl 5,6-dimethoxy-1-benzothiophene-2-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of ethyl 5,6-dimethoxy-1-benzothiophene-2-carboxylate?
The IUPAC name of ethyl 5,6-dimethoxy-1-benzothiophene-2-carboxylate (CID 45104330) is ethyl 5,6-dimethoxy-1-benzothiophene-2-carboxylate.
What is the SMILES notation for ethyl 5,6-dimethoxy-1-benzothiophene-2-carboxylate?
The canonical SMILES for ethyl 5,6-dimethoxy-1-benzothiophene-2-carboxylate is CCOC(=O)c1cc2cc(OC)c(OC)cc2s1.
What is the InChIKey of ethyl 5,6-dimethoxy-1-benzothiophene-2-carboxylate?
The InChIKey is XIYUVNDNLSBEKN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14O4S/c1-4-17-13(14)12-6-8-5-9(15-2)10(16-3)7-11(8)18-12/h5-7H,4H2,1-3H3.
What are the key properties of ethyl 5,6-dimethoxy-1-benzothiophene-2-carboxylate?
ethyl 5,6-dimethoxy-1-benzothiophene-2-carboxylate has a molecular weight of 266.32 g/mol, XLogP of 3.10, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 5,6-dimethoxy-1-benzothiophene-2-carboxylate is sourced from PubChem (CID 45104330), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).