About 6-methyl-3-(4-methylphenyl)-2,4-dihydro-1,3-benzoxazine
6-methyl-3-(4-methylphenyl)-2,4-dihydro-1,3-benzoxazine (PubChem CID 45104901) has the molecular formula C16H17NO
and a molecular weight of 239.32 g/mol. Its IUPAC name is 6-methyl-3-(4-methylphenyl)-2,4-dihydro-1,3-benzoxazine.
Molecular Properties
| Compound Name | 6-methyl-3-(4-methylphenyl)-2,4-dihydro-1,3-benzoxazine |
| PubChem CID | 45104901 |
| Molecular Formula | C16H17NO |
| Molecular Weight | 239.32 g/mol |
| Exact Mass | 239.13 |
| IUPAC Name | 6-methyl-3-(4-methylphenyl)-2,4-dihydro-1,3-benzoxazine |
| SMILES | Cc1ccc(N2COc3ccc(C)cc3C2)cc1 |
| InChI | InChI=1S/C16H17NO/c1-12-3-6-15(7-4-12)17-10-14-9-13(2)5-8-16(14)18-11-17/h3-9H,10-11H2,1-2H3 |
| InChIKey | KCQSULBGJSFNFJ-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.32 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|
Analyze 6-methyl-3-(4-methylphenyl)-2,4-dihydro-1,3-benzoxazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-3-(4-methylphenyl)-2,4-dihydro-1,3-benzoxazine?
The IUPAC name of 6-methyl-3-(4-methylphenyl)-2,4-dihydro-1,3-benzoxazine (CID 45104901) is 6-methyl-3-(4-methylphenyl)-2,4-dihydro-1,3-benzoxazine.
What is the SMILES notation for 6-methyl-3-(4-methylphenyl)-2,4-dihydro-1,3-benzoxazine?
The canonical SMILES for 6-methyl-3-(4-methylphenyl)-2,4-dihydro-1,3-benzoxazine is Cc1ccc(N2COc3ccc(C)cc3C2)cc1.
What is the InChIKey of 6-methyl-3-(4-methylphenyl)-2,4-dihydro-1,3-benzoxazine?
The InChIKey is KCQSULBGJSFNFJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17NO/c1-12-3-6-15(7-4-12)17-10-14-9-13(2)5-8-16(14)18-11-17/h3-9H,10-11H2,1-2H3.
What are the key properties of 6-methyl-3-(4-methylphenyl)-2,4-dihydro-1,3-benzoxazine?
6-methyl-3-(4-methylphenyl)-2,4-dihydro-1,3-benzoxazine has a molecular weight of 239.32 g/mol, XLogP of 3.66, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-3-(4-methylphenyl)-2,4-dihydro-1,3-benzoxazine is sourced from PubChem (CID 45104901), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).