About (3R)-3-(2,4-dichlorophenyl)-N,5-dihydroxypentanamide
(3R)-3-(2,4-dichlorophenyl)-N,5-dihydroxypentanamide (PubChem CID 45105065) has the molecular formula C11H13Cl2NO3
and a molecular weight of 278.13 g/mol. Its IUPAC name is (3R)-3-(2,4-dichlorophenyl)-N,5-dihydroxypentanamide.
Molecular Properties
| Compound Name | (3R)-3-(2,4-dichlorophenyl)-N,5-dihydroxypentanamide |
| PubChem CID | 45105065 |
| Molecular Formula | C11H13Cl2NO3 |
| Molecular Weight | 278.13 g/mol |
| Exact Mass | 277.03 |
| IUPAC Name | (3R)-3-(2,4-dichlorophenyl)-N,5-dihydroxypentanamide |
| SMILES | O=C(C[C@@H](CCO)c1ccc(Cl)cc1Cl)NO |
| InChI | InChI=1S/C11H13Cl2NO3/c12-8-1-2-9(10(13)6-8)7(3-4-15)5-11(16)14-17/h1-2,6-7,15,17H,3-5H2,(H,14,16)/t7-/m1/s1 |
| InChIKey | WWKGAIHIFOJBCT-SSDOTTSWSA-N |
| XLogP | 2.35 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.13 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (3R)-3-(2,4-dichlorophenyl)-N,5-dihydroxypentanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-3-(2,4-dichlorophenyl)-N,5-dihydroxypentanamide?
The IUPAC name of (3R)-3-(2,4-dichlorophenyl)-N,5-dihydroxypentanamide (CID 45105065) is (3R)-3-(2,4-dichlorophenyl)-N,5-dihydroxypentanamide.
What is the SMILES notation for (3R)-3-(2,4-dichlorophenyl)-N,5-dihydroxypentanamide?
The canonical SMILES for (3R)-3-(2,4-dichlorophenyl)-N,5-dihydroxypentanamide is O=C(C[C@@H](CCO)c1ccc(Cl)cc1Cl)NO.
What is the InChIKey of (3R)-3-(2,4-dichlorophenyl)-N,5-dihydroxypentanamide?
The InChIKey is WWKGAIHIFOJBCT-SSDOTTSWSA-N. The full InChI is InChI=1S/C11H13Cl2NO3/c12-8-1-2-9(10(13)6-8)7(3-4-15)5-11(16)14-17/h1-2,6-7,15,17H,3-5H2,(H,14,16)/t7-/m1/s1.
What are the key properties of (3R)-3-(2,4-dichlorophenyl)-N,5-dihydroxypentanamide?
(3R)-3-(2,4-dichlorophenyl)-N,5-dihydroxypentanamide has a molecular weight of 278.13 g/mol, XLogP of 2.35, 5 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-3-(2,4-dichlorophenyl)-N,5-dihydroxypentanamide is sourced from PubChem (CID 45105065), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).