C24H17N3O5 — CID 45105504
3-(4-methylphenyl)-2-[(E)-2-(6-nitro-1,3-benzodioxol-5-yl)ethenyl]quinazolin-4-one (PubChem CID 45105504) has the molecular formula C24H17N3O5 and a molecular weight of 427.42 g/mol. Its IUPAC name is 3-(4-methylphenyl)-2-[(E)-2-(6-nitro-1,3-benzodioxol-5-yl)ethenyl]quinazolin-4-one.
| Compound Name | 3-(4-methylphenyl)-2-[(E)-2-(6-nitro-1,3-benzodioxol-5-yl)ethenyl]quinazolin-4-one |
|---|---|
| PubChem CID | 45105504 |
| Molecular Formula | C24H17N3O5 |
| Molecular Weight | 427.42 g/mol |
| Exact Mass | 427.12 |
| IUPAC Name | 3-(4-methylphenyl)-2-[(E)-2-(6-nitro-1,3-benzodioxol-5-yl)ethenyl]quinazolin-4-one |
| SMILES | Cc1ccc(-n2c(/C=C/c3cc4c(cc3[N+](=O)[O-])OCO4)nc3ccccc3c2=O)cc1 |
| InChI | InChI=1S/C24H17N3O5/c1-15-6-9-17(10-7-15)26-23(25-19-5-3-2-4-18(19)24(26)28)11-8-16-12-21-22(32-14-31-21)13-20(16)27(29)30/h2-13H,14H2,1H3/b11-8+ |
| InChIKey | YCPSHERFGBWUNO-DHZHZOJOSA-N |
| XLogP | 4.50 |
| TPSA | 96.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.42 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|