About (quinolin-3-ylamino) furan-2-carboxylate
(quinolin-3-ylamino) furan-2-carboxylate (PubChem CID 45105879) has the molecular formula C14H10N2O3
and a molecular weight of 254.25 g/mol. Its IUPAC name is (quinolin-3-ylamino) furan-2-carboxylate.
Molecular Properties
| Compound Name | (quinolin-3-ylamino) furan-2-carboxylate |
| PubChem CID | 45105879 |
| Molecular Formula | C14H10N2O3 |
| Molecular Weight | 254.25 g/mol |
| Exact Mass | 254.07 |
| IUPAC Name | (quinolin-3-ylamino) furan-2-carboxylate |
| SMILES | O=C(ONc1cnc2ccccc2c1)c1ccco1 |
| InChI | InChI=1S/C14H10N2O3/c17-14(13-6-3-7-18-13)19-16-11-8-10-4-1-2-5-12(10)15-9-11/h1-9,16H |
| InChIKey | ACIULNSCFFILPY-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.25 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (quinolin-3-ylamino) furan-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (quinolin-3-ylamino) furan-2-carboxylate?
The IUPAC name of (quinolin-3-ylamino) furan-2-carboxylate (CID 45105879) is (quinolin-3-ylamino) furan-2-carboxylate.
What is the SMILES notation for (quinolin-3-ylamino) furan-2-carboxylate?
The canonical SMILES for (quinolin-3-ylamino) furan-2-carboxylate is O=C(ONc1cnc2ccccc2c1)c1ccco1.
What is the InChIKey of (quinolin-3-ylamino) furan-2-carboxylate?
The InChIKey is ACIULNSCFFILPY-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10N2O3/c17-14(13-6-3-7-18-13)19-16-11-8-10-4-1-2-5-12(10)15-9-11/h1-9,16H.
What are the key properties of (quinolin-3-ylamino) furan-2-carboxylate?
(quinolin-3-ylamino) furan-2-carboxylate has a molecular weight of 254.25 g/mol, XLogP of 3.01, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (quinolin-3-ylamino) furan-2-carboxylate is sourced from PubChem (CID 45105879), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).