About (2E,4Z)-2,4-bis[(2-methoxyphenyl)methylidene]-8-methyl-8-azabicyclo[3.2.1]octan-3-one
(2E,4Z)-2,4-bis[(2-methoxyphenyl)methylidene]-8-methyl-8-azabicyclo[3.2.1]octan-3-one (PubChem CID 45105991) has the molecular formula C24H25NO3
and a molecular weight of 375.47 g/mol. Its IUPAC name is (2E,4Z)-2,4-bis[(2-methoxyphenyl)methylidene]-8-methyl-8-azabicyclo[3.2.1]octan-3-one.
Molecular Properties
| Compound Name | (2E,4Z)-2,4-bis[(2-methoxyphenyl)methylidene]-8-methyl-8-azabicyclo[3.2.1]octan-3-one |
| PubChem CID | 45105991 |
| Molecular Formula | C24H25NO3 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.18 |
| IUPAC Name | (2E,4Z)-2,4-bis[(2-methoxyphenyl)methylidene]-8-methyl-8-azabicyclo[3.2.1]octan-3-one |
| SMILES | COc1ccccc1/C=C1\C(=O)/C(=C/c2ccccc2OC)C2CCC1N2C |
| InChI | InChI=1S/C24H25NO3/c1-25-20-12-13-21(25)19(15-17-9-5-7-11-23(17)28-3)24(26)18(20)14-16-8-4-6-10-22(16)27-2/h4-11,14-15,20-21H,12-13H2,1-3H3/b18-14-,19-15+ |
| InChIKey | HIRMWWYODIFCLY-KPNKYRRCSA-N |
| XLogP | 4.22 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (2E,4Z)-2,4-bis[(2-methoxyphenyl)methylidene]-8-methyl-8-azabicyclo[3.2.1]octan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E,4Z)-2,4-bis[(2-methoxyphenyl)methylidene]-8-methyl-8-azabicyclo[3.2.1]octan-3-one?
The IUPAC name of (2E,4Z)-2,4-bis[(2-methoxyphenyl)methylidene]-8-methyl-8-azabicyclo[3.2.1]octan-3-one (CID 45105991) is (2E,4Z)-2,4-bis[(2-methoxyphenyl)methylidene]-8-methyl-8-azabicyclo[3.2.1]octan-3-one.
What is the SMILES notation for (2E,4Z)-2,4-bis[(2-methoxyphenyl)methylidene]-8-methyl-8-azabicyclo[3.2.1]octan-3-one?
The canonical SMILES for (2E,4Z)-2,4-bis[(2-methoxyphenyl)methylidene]-8-methyl-8-azabicyclo[3.2.1]octan-3-one is COc1ccccc1/C=C1\C(=O)/C(=C/c2ccccc2OC)C2CCC1N2C.
What is the InChIKey of (2E,4Z)-2,4-bis[(2-methoxyphenyl)methylidene]-8-methyl-8-azabicyclo[3.2.1]octan-3-one?
The InChIKey is HIRMWWYODIFCLY-KPNKYRRCSA-N. The full InChI is InChI=1S/C24H25NO3/c1-25-20-12-13-21(25)19(15-17-9-5-7-11-23(17)28-3)24(26)18(20)14-16-8-4-6-10-22(16)27-2/h4-11,14-15,20-21H,12-13H2,1-3H3/b18-14-,19-15+.
What are the key properties of (2E,4Z)-2,4-bis[(2-methoxyphenyl)methylidene]-8-methyl-8-azabicyclo[3.2.1]octan-3-one?
(2E,4Z)-2,4-bis[(2-methoxyphenyl)methylidene]-8-methyl-8-azabicyclo[3.2.1]octan-3-one has a molecular weight of 375.47 g/mol, XLogP of 4.22, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2E,4Z)-2,4-bis[(2-methoxyphenyl)methylidene]-8-methyl-8-azabicyclo[3.2.1]octan-3-one is sourced from PubChem (CID 45105991), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).