C26H23N3O2S — CID 45106591
1-[(1-benzyl-2-thiophen-2-ylindol-3-yl)methyl]-3-(furan-2-ylmethyl)urea (PubChem CID 45106591) has the molecular formula C26H23N3O2S and a molecular weight of 441.56 g/mol. Its IUPAC name is 1-[(1-benzyl-2-thiophen-2-ylindol-3-yl)methyl]-3-(furan-2-ylmethyl)urea.
| Compound Name | 1-[(1-benzyl-2-thiophen-2-ylindol-3-yl)methyl]-3-(furan-2-ylmethyl)urea |
|---|---|
| PubChem CID | 45106591 |
| Molecular Formula | C26H23N3O2S |
| Molecular Weight | 441.56 g/mol |
| Exact Mass | 441.15 |
| IUPAC Name | 1-[(1-benzyl-2-thiophen-2-ylindol-3-yl)methyl]-3-(furan-2-ylmethyl)urea |
| SMILES | O=C(NCc1ccco1)NCc1c(-c2cccs2)n(Cc2ccccc2)c2ccccc12 |
| InChI | InChI=1S/C26H23N3O2S/c30-26(27-16-20-10-6-14-31-20)28-17-22-21-11-4-5-12-23(21)29(18-19-8-2-1-3-9-19)25(22)24-13-7-15-32-24/h1-15H,16-18H2,(H2,27,28,30) |
| InChIKey | BEMJWTHKDQKMHX-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 59.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.56 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|