C17H23N3O4S2 — CID 45107469
[4-[(2S)-2-(2,2-dimethylpropanoylamino)-2-(4-methyl-1,3-thiazol-2-yl)ethyl]phenyl]sulfamic acid (PubChem CID 45107469) has the molecular formula C17H23N3O4S2 and a molecular weight of 397.52 g/mol. Its IUPAC name is [4-[(2S)-2-(2,2-dimethylpropanoylamino)-2-(4-methyl-1,3-thiazol-2-yl)ethyl]phenyl]sulfamic acid.
| Compound Name | [4-[(2S)-2-(2,2-dimethylpropanoylamino)-2-(4-methyl-1,3-thiazol-2-yl)ethyl]phenyl]sulfamic acid |
|---|---|
| PubChem CID | 45107469 |
| Molecular Formula | C17H23N3O4S2 |
| Molecular Weight | 397.52 g/mol |
| Exact Mass | 397.11 |
| IUPAC Name | [4-[(2S)-2-(2,2-dimethylpropanoylamino)-2-(4-methyl-1,3-thiazol-2-yl)ethyl]phenyl]sulfamic acid |
| SMILES | Cc1csc([C@H](Cc2ccc(NS(=O)(=O)O)cc2)NC(=O)C(C)(C)C)n1 |
| InChI | InChI=1S/C17H23N3O4S2/c1-11-10-25-15(18-11)14(19-16(21)17(2,3)4)9-12-5-7-13(8-6-12)20-26(22,23)24/h5-8,10,14,20H,9H2,1-4H3,(H,19,21)(H,22,23,24)/t14-/m0/s1 |
| InChIKey | QDLLTACANIARFO-AWEZNQCLSA-N |
| XLogP | 3.11 |
| TPSA | 108.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.52 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|