About (4Z)-4-(3,4-dichlorophenyl)-4-methoxyimino-3-methylbutanoic acid
(4Z)-4-(3,4-dichlorophenyl)-4-methoxyimino-3-methylbutanoic acid (PubChem CID 45107935) has the molecular formula C12H13Cl2NO3
and a molecular weight of 290.15 g/mol. Its IUPAC name is (4Z)-4-(3,4-dichlorophenyl)-4-methoxyimino-3-methylbutanoic acid.
Molecular Properties
| Compound Name | (4Z)-4-(3,4-dichlorophenyl)-4-methoxyimino-3-methylbutanoic acid |
| PubChem CID | 45107935 |
| Molecular Formula | C12H13Cl2NO3 |
| Molecular Weight | 290.15 g/mol |
| Exact Mass | 289.03 |
| IUPAC Name | (4Z)-4-(3,4-dichlorophenyl)-4-methoxyimino-3-methylbutanoic acid |
| SMILES | CO/N=C(\c1ccc(Cl)c(Cl)c1)C(C)CC(=O)O |
| InChI | InChI=1S/C12H13Cl2NO3/c1-7(5-11(16)17)12(15-18-2)8-3-4-9(13)10(14)6-8/h3-4,6-7H,5H2,1-2H3,(H,16,17)/b15-12- |
| InChIKey | CCOGOBCQMYPYSU-QINSGFPZSA-N |
| XLogP | 3.45 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.15 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (4Z)-4-(3,4-dichlorophenyl)-4-methoxyimino-3-methylbutanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4Z)-4-(3,4-dichlorophenyl)-4-methoxyimino-3-methylbutanoic acid?
The IUPAC name of (4Z)-4-(3,4-dichlorophenyl)-4-methoxyimino-3-methylbutanoic acid (CID 45107935) is (4Z)-4-(3,4-dichlorophenyl)-4-methoxyimino-3-methylbutanoic acid.
What is the SMILES notation for (4Z)-4-(3,4-dichlorophenyl)-4-methoxyimino-3-methylbutanoic acid?
The canonical SMILES for (4Z)-4-(3,4-dichlorophenyl)-4-methoxyimino-3-methylbutanoic acid is CO/N=C(\c1ccc(Cl)c(Cl)c1)C(C)CC(=O)O.
What is the InChIKey of (4Z)-4-(3,4-dichlorophenyl)-4-methoxyimino-3-methylbutanoic acid?
The InChIKey is CCOGOBCQMYPYSU-QINSGFPZSA-N. The full InChI is InChI=1S/C12H13Cl2NO3/c1-7(5-11(16)17)12(15-18-2)8-3-4-9(13)10(14)6-8/h3-4,6-7H,5H2,1-2H3,(H,16,17)/b15-12-.
What are the key properties of (4Z)-4-(3,4-dichlorophenyl)-4-methoxyimino-3-methylbutanoic acid?
(4Z)-4-(3,4-dichlorophenyl)-4-methoxyimino-3-methylbutanoic acid has a molecular weight of 290.15 g/mol, XLogP of 3.45, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4Z)-4-(3,4-dichlorophenyl)-4-methoxyimino-3-methylbutanoic acid is sourced from PubChem (CID 45107935), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).