About hexan-3-yl benzoate
hexan-3-yl benzoate (PubChem CID 45108325) has the molecular formula C13H18O2
and a molecular weight of 206.29 g/mol. Its IUPAC name is hexan-3-yl benzoate.
Molecular Properties
| Compound Name | hexan-3-yl benzoate |
| PubChem CID | 45108325 |
| Molecular Formula | C13H18O2 |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.13 |
| IUPAC Name | hexan-3-yl benzoate |
| SMILES | CCCC(CC)OC(=O)c1ccccc1 |
| InChI | InChI=1S/C13H18O2/c1-3-8-12(4-2)15-13(14)11-9-6-5-7-10-11/h5-7,9-10,12H,3-4,8H2,1-2H3 |
| InChIKey | ZUUPNDANIDMUPX-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze hexan-3-yl benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hexan-3-yl benzoate?
The IUPAC name of hexan-3-yl benzoate (CID 45108325) is hexan-3-yl benzoate.
What is the SMILES notation for hexan-3-yl benzoate?
The canonical SMILES for hexan-3-yl benzoate is CCCC(CC)OC(=O)c1ccccc1.
What is the InChIKey of hexan-3-yl benzoate?
The InChIKey is ZUUPNDANIDMUPX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18O2/c1-3-8-12(4-2)15-13(14)11-9-6-5-7-10-11/h5-7,9-10,12H,3-4,8H2,1-2H3.
What are the key properties of hexan-3-yl benzoate?
hexan-3-yl benzoate has a molecular weight of 206.29 g/mol, XLogP of 3.42, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for hexan-3-yl benzoate is sourced from PubChem (CID 45108325), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).