About 1-(2,4-dimethylphenyl)-3-morpholin-4-ylpropan-1-one chloride
1-(2,4-dimethylphenyl)-3-morpholin-4-ylpropan-1-one chloride (PubChem CID 45108470) has the molecular formula C15H21ClNO2-
and a molecular weight of 282.79 g/mol. Its IUPAC name is 1-(2,4-dimethylphenyl)-3-morpholin-4-ylpropan-1-one chloride.
Molecular Properties
| Compound Name | 1-(2,4-dimethylphenyl)-3-morpholin-4-ylpropan-1-one chloride |
| PubChem CID | 45108470 |
| Molecular Formula | C15H21ClNO2- |
| Molecular Weight | 282.79 g/mol |
| Exact Mass | 282.13 |
| IUPAC Name | 1-(2,4-dimethylphenyl)-3-morpholin-4-ylpropan-1-one chloride |
| SMILES | Cc1ccc(C(=O)CCN2CCOCC2)c(C)c1.[Cl-] |
| InChI | InChI=1S/C15H21NO2.ClH/c1-12-3-4-14(13(2)11-12)15(17)5-6-16-7-9-18-10-8-16;/h3-4,11H,5-10H2,1-2H3;1H/p-1 |
| InChIKey | RCYRPDJIUVAAOK-UHFFFAOYSA-M |
| XLogP | -0.79 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.79 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(2,4-dimethylphenyl)-3-morpholin-4-ylpropan-1-one chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,4-dimethylphenyl)-3-morpholin-4-ylpropan-1-one chloride?
The IUPAC name of 1-(2,4-dimethylphenyl)-3-morpholin-4-ylpropan-1-one chloride (CID 45108470) is 1-(2,4-dimethylphenyl)-3-morpholin-4-ylpropan-1-one chloride.
What is the SMILES notation for 1-(2,4-dimethylphenyl)-3-morpholin-4-ylpropan-1-one chloride?
The canonical SMILES for 1-(2,4-dimethylphenyl)-3-morpholin-4-ylpropan-1-one chloride is Cc1ccc(C(=O)CCN2CCOCC2)c(C)c1.[Cl-].
What is the InChIKey of 1-(2,4-dimethylphenyl)-3-morpholin-4-ylpropan-1-one chloride?
The InChIKey is RCYRPDJIUVAAOK-UHFFFAOYSA-M. The full InChI is InChI=1S/C15H21NO2.ClH/c1-12-3-4-14(13(2)11-12)15(17)5-6-16-7-9-18-10-8-16;/h3-4,11H,5-10H2,1-2H3;1H/p-1.
What are the key properties of 1-(2,4-dimethylphenyl)-3-morpholin-4-ylpropan-1-one chloride?
1-(2,4-dimethylphenyl)-3-morpholin-4-ylpropan-1-one chloride has a molecular weight of 282.79 g/mol, XLogP of -0.79, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,4-dimethylphenyl)-3-morpholin-4-ylpropan-1-one chloride is sourced from PubChem (CID 45108470), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).