C11H16ClN2OS- — CID 45108547
N-(thiophen-3-ylmethyl)piperidine-2-carboxamide chloride (PubChem CID 45108547) has the molecular formula C11H16ClN2OS- and a molecular weight of 259.78 g/mol. Its IUPAC name is N-(thiophen-3-ylmethyl)piperidine-2-carboxamide chloride.
| Compound Name | N-(thiophen-3-ylmethyl)piperidine-2-carboxamide chloride |
|---|---|
| PubChem CID | 45108547 |
| Molecular Formula | C11H16ClN2OS- |
| Molecular Weight | 259.78 g/mol |
| Exact Mass | 259.07 |
| IUPAC Name | N-(thiophen-3-ylmethyl)piperidine-2-carboxamide chloride |
| SMILES | O=C(NCc1ccsc1)C1CCCCN1.[Cl-] |
| InChI | InChI=1S/C11H16N2OS.ClH/c14-11(10-3-1-2-5-12-10)13-7-9-4-6-15-8-9;/h4,6,8,10,12H,1-3,5,7H2,(H,13,14);1H/p-1 |
| InChIKey | KXVWOVXTLYFORO-UHFFFAOYSA-M |
| XLogP | -1.49 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.78 |
| LogP ≤ 5 | -1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |