About [(E)-1-[4-(2-fluorophenyl)phenyl]propylideneamino] N-phenylcarbamate
[(E)-1-[4-(2-fluorophenyl)phenyl]propylideneamino] N-phenylcarbamate (PubChem CID 45108664) has the molecular formula C22H19FN2O2
and a molecular weight of 362.40 g/mol. Its IUPAC name is [(E)-1-[4-(2-fluorophenyl)phenyl]propylideneamino] N-phenylcarbamate.
Molecular Properties
| Compound Name | [(E)-1-[4-(2-fluorophenyl)phenyl]propylideneamino] N-phenylcarbamate |
| PubChem CID | 45108664 |
| Molecular Formula | C22H19FN2O2 |
| Molecular Weight | 362.40 g/mol |
| Exact Mass | 362.14 |
| IUPAC Name | [(E)-1-[4-(2-fluorophenyl)phenyl]propylideneamino] N-phenylcarbamate |
| SMILES | CC/C(=N\OC(=O)Nc1ccccc1)c1ccc(-c2ccccc2F)cc1 |
| InChI | InChI=1S/C22H19FN2O2/c1-2-21(25-27-22(26)24-18-8-4-3-5-9-18)17-14-12-16(13-15-17)19-10-6-7-11-20(19)23/h3-15H,2H2,1H3,(H,24,26)/b25-21+ |
| InChIKey | TTWICNZMUKQRGG-NJNXFGOHSA-N |
| XLogP | 5.86 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 362.40 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [(E)-1-[4-(2-fluorophenyl)phenyl]propylideneamino] N-phenylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-1-[4-(2-fluorophenyl)phenyl]propylideneamino] N-phenylcarbamate?
The IUPAC name of [(E)-1-[4-(2-fluorophenyl)phenyl]propylideneamino] N-phenylcarbamate (CID 45108664) is [(E)-1-[4-(2-fluorophenyl)phenyl]propylideneamino] N-phenylcarbamate.
What is the SMILES notation for [(E)-1-[4-(2-fluorophenyl)phenyl]propylideneamino] N-phenylcarbamate?
The canonical SMILES for [(E)-1-[4-(2-fluorophenyl)phenyl]propylideneamino] N-phenylcarbamate is CC/C(=N\OC(=O)Nc1ccccc1)c1ccc(-c2ccccc2F)cc1.
What is the InChIKey of [(E)-1-[4-(2-fluorophenyl)phenyl]propylideneamino] N-phenylcarbamate?
The InChIKey is TTWICNZMUKQRGG-NJNXFGOHSA-N. The full InChI is InChI=1S/C22H19FN2O2/c1-2-21(25-27-22(26)24-18-8-4-3-5-9-18)17-14-12-16(13-15-17)19-10-6-7-11-20(19)23/h3-15H,2H2,1H3,(H,24,26)/b25-21+.
What are the key properties of [(E)-1-[4-(2-fluorophenyl)phenyl]propylideneamino] N-phenylcarbamate?
[(E)-1-[4-(2-fluorophenyl)phenyl]propylideneamino] N-phenylcarbamate has a molecular weight of 362.40 g/mol, XLogP of 5.86, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-1-[4-(2-fluorophenyl)phenyl]propylideneamino] N-phenylcarbamate is sourced from PubChem (CID 45108664), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).