About 4-tert-butyl-2-[4-(trifluoromethoxy)phenyl]-1,3-thiazole bromide
4-tert-butyl-2-[4-(trifluoromethoxy)phenyl]-1,3-thiazole bromide (PubChem CID 45108883) has the molecular formula C14H14BrF3NOS-
and a molecular weight of 381.24 g/mol. Its IUPAC name is 4-tert-butyl-2-[4-(trifluoromethoxy)phenyl]-1,3-thiazole bromide.
Molecular Properties
| Compound Name | 4-tert-butyl-2-[4-(trifluoromethoxy)phenyl]-1,3-thiazole bromide |
| PubChem CID | 45108883 |
| Molecular Formula | C14H14BrF3NOS- |
| Molecular Weight | 381.24 g/mol |
| Exact Mass | 379.99 |
| IUPAC Name | 4-tert-butyl-2-[4-(trifluoromethoxy)phenyl]-1,3-thiazole bromide |
| SMILES | CC(C)(C)c1csc(-c2ccc(OC(F)(F)F)cc2)n1.[Br-] |
| InChI | InChI=1S/C14H14F3NOS.BrH/c1-13(2,3)11-8-20-12(18-11)9-4-6-10(7-5-9)19-14(15,16)17;/h4-8H,1-3H3;1H/p-1 |
| InChIKey | FJXYOIABNWYFOZ-UHFFFAOYSA-M |
| XLogP | 2.01 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 381.24 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-tert-butyl-2-[4-(trifluoromethoxy)phenyl]-1,3-thiazole bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-tert-butyl-2-[4-(trifluoromethoxy)phenyl]-1,3-thiazole bromide?
The IUPAC name of 4-tert-butyl-2-[4-(trifluoromethoxy)phenyl]-1,3-thiazole bromide (CID 45108883) is 4-tert-butyl-2-[4-(trifluoromethoxy)phenyl]-1,3-thiazole bromide.
What is the SMILES notation for 4-tert-butyl-2-[4-(trifluoromethoxy)phenyl]-1,3-thiazole bromide?
The canonical SMILES for 4-tert-butyl-2-[4-(trifluoromethoxy)phenyl]-1,3-thiazole bromide is CC(C)(C)c1csc(-c2ccc(OC(F)(F)F)cc2)n1.[Br-].
What is the InChIKey of 4-tert-butyl-2-[4-(trifluoromethoxy)phenyl]-1,3-thiazole bromide?
The InChIKey is FJXYOIABNWYFOZ-UHFFFAOYSA-M. The full InChI is InChI=1S/C14H14F3NOS.BrH/c1-13(2,3)11-8-20-12(18-11)9-4-6-10(7-5-9)19-14(15,16)17;/h4-8H,1-3H3;1H/p-1.
What are the key properties of 4-tert-butyl-2-[4-(trifluoromethoxy)phenyl]-1,3-thiazole bromide?
4-tert-butyl-2-[4-(trifluoromethoxy)phenyl]-1,3-thiazole bromide has a molecular weight of 381.24 g/mol, XLogP of 2.01, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-tert-butyl-2-[4-(trifluoromethoxy)phenyl]-1,3-thiazole bromide is sourced from PubChem (CID 45108883), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).