About 2-cyclopropyl-N-[(E)-(3,5-dichlorophenyl)methylideneamino]quinoline-4-carboxamide
2-cyclopropyl-N-[(E)-(3,5-dichlorophenyl)methylideneamino]quinoline-4-carboxamide (PubChem CID 45108999) has the molecular formula C20H15Cl2N3O
and a molecular weight of 384.27 g/mol. Its IUPAC name is 2-cyclopropyl-N-[(E)-(3,5-dichlorophenyl)methylideneamino]quinoline-4-carboxamide.
Molecular Properties
| Compound Name | 2-cyclopropyl-N-[(E)-(3,5-dichlorophenyl)methylideneamino]quinoline-4-carboxamide |
| PubChem CID | 45108999 |
| Molecular Formula | C20H15Cl2N3O |
| Molecular Weight | 384.27 g/mol |
| Exact Mass | 383.06 |
| IUPAC Name | 2-cyclopropyl-N-[(E)-(3,5-dichlorophenyl)methylideneamino]quinoline-4-carboxamide |
| SMILES | O=C(N/N=C/c1cc(Cl)cc(Cl)c1)c1cc(C2CC2)nc2ccccc12 |
| InChI | InChI=1S/C20H15Cl2N3O/c21-14-7-12(8-15(22)9-14)11-23-25-20(26)17-10-19(13-5-6-13)24-18-4-2-1-3-16(17)18/h1-4,7-11,13H,5-6H2,(H,25,26)/b23-11+ |
| InChIKey | VHGKGRDTRCGVOG-FOKLQQMPSA-N |
| XLogP | 5.18 |
| TPSA | 54.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 384.27 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-cyclopropyl-N-[(E)-(3,5-dichlorophenyl)methylideneamino]quinoline-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclopropyl-N-[(E)-(3,5-dichlorophenyl)methylideneamino]quinoline-4-carboxamide?
The IUPAC name of 2-cyclopropyl-N-[(E)-(3,5-dichlorophenyl)methylideneamino]quinoline-4-carboxamide (CID 45108999) is 2-cyclopropyl-N-[(E)-(3,5-dichlorophenyl)methylideneamino]quinoline-4-carboxamide.
What is the SMILES notation for 2-cyclopropyl-N-[(E)-(3,5-dichlorophenyl)methylideneamino]quinoline-4-carboxamide?
The canonical SMILES for 2-cyclopropyl-N-[(E)-(3,5-dichlorophenyl)methylideneamino]quinoline-4-carboxamide is O=C(N/N=C/c1cc(Cl)cc(Cl)c1)c1cc(C2CC2)nc2ccccc12.
What is the InChIKey of 2-cyclopropyl-N-[(E)-(3,5-dichlorophenyl)methylideneamino]quinoline-4-carboxamide?
The InChIKey is VHGKGRDTRCGVOG-FOKLQQMPSA-N. The full InChI is InChI=1S/C20H15Cl2N3O/c21-14-7-12(8-15(22)9-14)11-23-25-20(26)17-10-19(13-5-6-13)24-18-4-2-1-3-16(17)18/h1-4,7-11,13H,5-6H2,(H,25,26)/b23-11+.
What are the key properties of 2-cyclopropyl-N-[(E)-(3,5-dichlorophenyl)methylideneamino]quinoline-4-carboxamide?
2-cyclopropyl-N-[(E)-(3,5-dichlorophenyl)methylideneamino]quinoline-4-carboxamide has a molecular weight of 384.27 g/mol, XLogP of 5.18, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclopropyl-N-[(E)-(3,5-dichlorophenyl)methylideneamino]quinoline-4-carboxamide is sourced from PubChem (CID 45108999), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).