C19H21N3O5 — CID 45109190
tert-butyl [2-methoxy-4-[(E)-(pyridine-4-carbonylhydrazinylidene)methyl]phenyl] carbonate (PubChem CID 45109190) has the molecular formula C19H21N3O5 and a molecular weight of 371.39 g/mol. Its IUPAC name is tert-butyl [2-methoxy-4-[(E)-(pyridine-4-carbonylhydrazinylidene)methyl]phenyl] carbonate.
| Compound Name | tert-butyl [2-methoxy-4-[(E)-(pyridine-4-carbonylhydrazinylidene)methyl]phenyl] carbonate |
|---|---|
| PubChem CID | 45109190 |
| Molecular Formula | C19H21N3O5 |
| Molecular Weight | 371.39 g/mol |
| Exact Mass | 371.15 |
| IUPAC Name | tert-butyl [2-methoxy-4-[(E)-(pyridine-4-carbonylhydrazinylidene)methyl]phenyl] carbonate |
| SMILES | COc1cc(/C=N/NC(=O)c2ccncc2)ccc1OC(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H21N3O5/c1-19(2,3)27-18(24)26-15-6-5-13(11-16(15)25-4)12-21-22-17(23)14-7-9-20-10-8-14/h5-12H,1-4H3,(H,22,23)/b21-12+ |
| InChIKey | BHOCJPYCXUMTNW-CIAFOILYSA-N |
| XLogP | 3.17 |
| TPSA | 99.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.39 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|