About 5-(4-chlorophenyl)-2-pyrrolidin-1-yl-6H-1,3,4-thiadiazine bromide
5-(4-chlorophenyl)-2-pyrrolidin-1-yl-6H-1,3,4-thiadiazine bromide (PubChem CID 45109682) has the molecular formula C13H14BrClN3S-
and a molecular weight of 359.70 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-2-pyrrolidin-1-yl-6H-1,3,4-thiadiazine bromide.
Molecular Properties
| Compound Name | 5-(4-chlorophenyl)-2-pyrrolidin-1-yl-6H-1,3,4-thiadiazine bromide |
| PubChem CID | 45109682 |
| Molecular Formula | C13H14BrClN3S- |
| Molecular Weight | 359.70 g/mol |
| Exact Mass | 357.98 |
| IUPAC Name | 5-(4-chlorophenyl)-2-pyrrolidin-1-yl-6H-1,3,4-thiadiazine bromide |
| SMILES | Clc1ccc(C2=NN=C(N3CCCC3)SC2)cc1.[Br-] |
| InChI | InChI=1S/C13H14ClN3S.BrH/c14-11-5-3-10(4-6-11)12-9-18-13(16-15-12)17-7-1-2-8-17;/h3-6H,1-2,7-9H2;1H/p-1 |
| InChIKey | RBQLVBGCTAOBFD-UHFFFAOYSA-M |
| XLogP | 0.25 |
| TPSA | 27.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 359.70 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-(4-chlorophenyl)-2-pyrrolidin-1-yl-6H-1,3,4-thiadiazine bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4-chlorophenyl)-2-pyrrolidin-1-yl-6H-1,3,4-thiadiazine bromide?
The IUPAC name of 5-(4-chlorophenyl)-2-pyrrolidin-1-yl-6H-1,3,4-thiadiazine bromide (CID 45109682) is 5-(4-chlorophenyl)-2-pyrrolidin-1-yl-6H-1,3,4-thiadiazine bromide.
What is the SMILES notation for 5-(4-chlorophenyl)-2-pyrrolidin-1-yl-6H-1,3,4-thiadiazine bromide?
The canonical SMILES for 5-(4-chlorophenyl)-2-pyrrolidin-1-yl-6H-1,3,4-thiadiazine bromide is Clc1ccc(C2=NN=C(N3CCCC3)SC2)cc1.[Br-].
What is the InChIKey of 5-(4-chlorophenyl)-2-pyrrolidin-1-yl-6H-1,3,4-thiadiazine bromide?
The InChIKey is RBQLVBGCTAOBFD-UHFFFAOYSA-M. The full InChI is InChI=1S/C13H14ClN3S.BrH/c14-11-5-3-10(4-6-11)12-9-18-13(16-15-12)17-7-1-2-8-17;/h3-6H,1-2,7-9H2;1H/p-1.
What are the key properties of 5-(4-chlorophenyl)-2-pyrrolidin-1-yl-6H-1,3,4-thiadiazine bromide?
5-(4-chlorophenyl)-2-pyrrolidin-1-yl-6H-1,3,4-thiadiazine bromide has a molecular weight of 359.70 g/mol, XLogP of 0.25, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4-chlorophenyl)-2-pyrrolidin-1-yl-6H-1,3,4-thiadiazine bromide is sourced from PubChem (CID 45109682), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).