C9H18BrNO4 — CID 45109728
[(3aR,6R,6aR)-3,5-dihydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]-trimethylazanium bromide (PubChem CID 45109728) has the molecular formula C9H18BrNO4 and a molecular weight of 284.15 g/mol. Its IUPAC name is [(3aR,6R,6aR)-3,5-dihydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]-trimethylazanium bromide.
| Compound Name | [(3aR,6R,6aR)-3,5-dihydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]-trimethylazanium bromide |
|---|---|
| PubChem CID | 45109728 |
| Molecular Formula | C9H18BrNO4 |
| Molecular Weight | 284.15 g/mol |
| Exact Mass | 283.04 |
| IUPAC Name | [(3aR,6R,6aR)-3,5-dihydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]-trimethylazanium bromide |
| SMILES | C[N+](C)(C)[C@H]1C(O)O[C@@H]2C(O)CO[C@@H]21.[Br-] |
| InChI | InChI=1S/C9H18NO4.BrH/c1-10(2,3)6-8-7(14-9(6)12)5(11)4-13-8;/h5-9,11-12H,4H2,1-3H3;1H/q+1;/p-1/t5?,6-,7-,8-,9?;/m1./s1 |
| InChIKey | ODPYZSOFLYCSDK-WVGQMDDGSA-M |
| XLogP | -4.46 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.15 |
| LogP ≤ 5 | -4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|