C20H35NO — CID 45109865
4-[6-[(1E,3E,7Z)-undeca-1,3,7-trienyl]piperidin-2-yl]butan-1-ol (PubChem CID 45109865) has the molecular formula C20H35NO and a molecular weight of 305.51 g/mol. Its IUPAC name is 4-[6-[(1E,3E,7Z)-undeca-1,3,7-trienyl]piperidin-2-yl]butan-1-ol.
| Compound Name | 4-[6-[(1E,3E,7Z)-undeca-1,3,7-trienyl]piperidin-2-yl]butan-1-ol |
|---|---|
| PubChem CID | 45109865 |
| Molecular Formula | C20H35NO |
| Molecular Weight | 305.51 g/mol |
| Exact Mass | 305.27 |
| IUPAC Name | 4-[6-[(1E,3E,7Z)-undeca-1,3,7-trienyl]piperidin-2-yl]butan-1-ol |
| SMILES | CCC/C=C\CC/C=C/C=C/C1CCCC(CCCCO)N1 |
| InChI | InChI=1S/C20H35NO/c1-2-3-4-5-6-7-8-9-10-14-19-16-13-17-20(21-19)15-11-12-18-22/h4-5,8-10,14,19-22H,2-3,6-7,11-13,15-18H2,1H3/b5-4-,9-8+,14-10+ |
| InChIKey | SWJAJYNVBOUDCL-DOZYUARPSA-N |
| XLogP | 4.91 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.51 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|