C24H35FN4O4 — CID 45110156
N-[4-[2-[4-(5-fluoro-1,2-benzoxazol-3-yl)piperazin-1-yl]ethyl]cyclohexyl]-3,3-dimethoxypropanamide (PubChem CID 45110156) has the molecular formula C24H35FN4O4 and a molecular weight of 462.57 g/mol. Its IUPAC name is N-[4-[2-[4-(5-fluoro-1,2-benzoxazol-3-yl)piperazin-1-yl]ethyl]cyclohexyl]-3,3-dimethoxypropanamide.
| Compound Name | N-[4-[2-[4-(5-fluoro-1,2-benzoxazol-3-yl)piperazin-1-yl]ethyl]cyclohexyl]-3,3-dimethoxypropanamide |
|---|---|
| PubChem CID | 45110156 |
| Molecular Formula | C24H35FN4O4 |
| Molecular Weight | 462.57 g/mol |
| Exact Mass | 462.26 |
| IUPAC Name | N-[4-[2-[4-(5-fluoro-1,2-benzoxazol-3-yl)piperazin-1-yl]ethyl]cyclohexyl]-3,3-dimethoxypropanamide |
| SMILES | COC(CC(=O)NC1CCC(CCN2CCN(c3noc4ccc(F)cc34)CC2)CC1)OC |
| InChI | InChI=1S/C24H35FN4O4/c1-31-23(32-2)16-22(30)26-19-6-3-17(4-7-19)9-10-28-11-13-29(14-12-28)24-20-15-18(25)5-8-21(20)33-27-24/h5,8,15,17,19,23H,3-4,6-7,9-14,16H2,1-2H3,(H,26,30) |
| InChIKey | RSQNBIBUOIAZGA-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 80.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.57 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|