C26H31F6N7O3 — CID 45110295
1-(2-amino-3-methylbutanoyl)-N-[4-oxo-4-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]-1-(2,4,5-trifluorophenyl)butan-2-yl]pyrrolidine-2-carboxamide (PubChem CID 45110295) has the molecular formula C26H31F6N7O3 and a molecular weight of 603.57 g/mol. Its IUPAC name is 1-(2-amino-3-methylbutanoyl)-N-[4-oxo-4-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]-1-(2,4,5-trifluorophenyl)butan-2-yl]pyrrolidine-2-carboxamide.
| Compound Name | 1-(2-amino-3-methylbutanoyl)-N-[4-oxo-4-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]-1-(2,4,5-trifluorophenyl)butan-2-yl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 45110295 |
| Molecular Formula | C26H31F6N7O3 |
| Molecular Weight | 603.57 g/mol |
| Exact Mass | 603.24 |
| IUPAC Name | 1-(2-amino-3-methylbutanoyl)-N-[4-oxo-4-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]-1-(2,4,5-trifluorophenyl)butan-2-yl]pyrrolidine-2-carboxamide |
| SMILES | CC(C)C(N)C(=O)N1CCCC1C(=O)NC(CC(=O)N1CCn2c(nnc2C(F)(F)F)C1)Cc1cc(F)c(F)cc1F |
| InChI | InChI=1S/C26H31F6N7O3/c1-13(2)22(33)24(42)38-5-3-4-19(38)23(41)34-15(8-14-9-17(28)18(29)11-16(14)27)10-21(40)37-6-7-39-20(12-37)35-36-25(39)26(30,31)32/h9,11,13,15,19,22H,3-8,10,12,33H2,1-2H3,(H,34,41) |
| InChIKey | NMABUCVVOKSFLL-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 126.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.57 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|