C24H28F6N6O4 — CID 45110296
tert-butyl N-[1-oxo-1-[[4-oxo-4-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]-1-(2,4,5-trifluorophenyl)butan-2-yl]amino]propan-2-yl]carbamate (PubChem CID 45110296) has the molecular formula C24H28F6N6O4 and a molecular weight of 578.51 g/mol. Its IUPAC name is tert-butyl N-[1-oxo-1-[[4-oxo-4-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]-1-(2,4,5-trifluorophenyl)butan-2-yl]amino]propan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-oxo-1-[[4-oxo-4-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]-1-(2,4,5-trifluorophenyl)butan-2-yl]amino]propan-2-yl]carbamate |
|---|---|
| PubChem CID | 45110296 |
| Molecular Formula | C24H28F6N6O4 |
| Molecular Weight | 578.51 g/mol |
| Exact Mass | 578.21 |
| IUPAC Name | tert-butyl N-[1-oxo-1-[[4-oxo-4-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]-1-(2,4,5-trifluorophenyl)butan-2-yl]amino]propan-2-yl]carbamate |
| SMILES | CC(NC(=O)OC(C)(C)C)C(=O)NC(CC(=O)N1CCn2c(nnc2C(F)(F)F)C1)Cc1cc(F)c(F)cc1F |
| InChI | InChI=1S/C24H28F6N6O4/c1-12(31-22(39)40-23(2,3)4)20(38)32-14(7-13-8-16(26)17(27)10-15(13)25)9-19(37)35-5-6-36-18(11-35)33-34-21(36)24(28,29)30/h8,10,12,14H,5-7,9,11H2,1-4H3,(H,31,39)(H,32,38) |
| InChIKey | YVHJTQYNZCSDQM-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 118.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.51 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|