C21H12ClI2N3O3 — CID 45110508
N-[5-chloro-2-iodo-4-(5-iodo-4-methyl-1,3-dioxoisoindol-2-yl)phenyl]pyridine-2-carboxamide (PubChem CID 45110508) has the molecular formula C21H12ClI2N3O3 and a molecular weight of 643.61 g/mol. Its IUPAC name is N-[5-chloro-2-iodo-4-(5-iodo-4-methyl-1,3-dioxoisoindol-2-yl)phenyl]pyridine-2-carboxamide.
| Compound Name | N-[5-chloro-2-iodo-4-(5-iodo-4-methyl-1,3-dioxoisoindol-2-yl)phenyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 45110508 |
| Molecular Formula | C21H12ClI2N3O3 |
| Molecular Weight | 643.61 g/mol |
| Exact Mass | 642.87 |
| IUPAC Name | N-[5-chloro-2-iodo-4-(5-iodo-4-methyl-1,3-dioxoisoindol-2-yl)phenyl]pyridine-2-carboxamide |
| SMILES | Cc1c(I)ccc2c1C(=O)N(c1cc(I)c(NC(=O)c3ccccn3)cc1Cl)C2=O |
| InChI | InChI=1S/C21H12ClI2N3O3/c1-10-13(23)6-5-11-18(10)21(30)27(20(11)29)17-9-14(24)16(8-12(17)22)26-19(28)15-4-2-3-7-25-15/h2-9H,1H3,(H,26,28) |
| InChIKey | JQWDPZJREKCEJT-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.61 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|