About N-methyl-3,6-diazabicyclo[3.2.2]nonane-3-carboxamide
N-methyl-3,6-diazabicyclo[3.2.2]nonane-3-carboxamide (PubChem CID 45110664) has the molecular formula C9H17N3O
and a molecular weight of 183.25 g/mol. Its IUPAC name is N-methyl-3,6-diazabicyclo[3.2.2]nonane-3-carboxamide.
Molecular Properties
| Compound Name | N-methyl-3,6-diazabicyclo[3.2.2]nonane-3-carboxamide |
| PubChem CID | 45110664 |
| Molecular Formula | C9H17N3O |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.14 |
| IUPAC Name | N-methyl-3,6-diazabicyclo[3.2.2]nonane-3-carboxamide |
| SMILES | CNC(=O)N1CC2CCC(C1)NC2 |
| InChI | InChI=1S/C9H17N3O/c1-10-9(13)12-5-7-2-3-8(6-12)11-4-7/h7-8,11H,2-6H2,1H3,(H,10,13) |
| InChIKey | IFPYZZWYEFTAOB-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-methyl-3,6-diazabicyclo[3.2.2]nonane-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-3,6-diazabicyclo[3.2.2]nonane-3-carboxamide?
The IUPAC name of N-methyl-3,6-diazabicyclo[3.2.2]nonane-3-carboxamide (CID 45110664) is N-methyl-3,6-diazabicyclo[3.2.2]nonane-3-carboxamide.
What is the SMILES notation for N-methyl-3,6-diazabicyclo[3.2.2]nonane-3-carboxamide?
The canonical SMILES for N-methyl-3,6-diazabicyclo[3.2.2]nonane-3-carboxamide is CNC(=O)N1CC2CCC(C1)NC2.
What is the InChIKey of N-methyl-3,6-diazabicyclo[3.2.2]nonane-3-carboxamide?
The InChIKey is IFPYZZWYEFTAOB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17N3O/c1-10-9(13)12-5-7-2-3-8(6-12)11-4-7/h7-8,11H,2-6H2,1H3,(H,10,13).
What are the key properties of N-methyl-3,6-diazabicyclo[3.2.2]nonane-3-carboxamide?
N-methyl-3,6-diazabicyclo[3.2.2]nonane-3-carboxamide has a molecular weight of 183.25 g/mol, XLogP of 0.01, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-3,6-diazabicyclo[3.2.2]nonane-3-carboxamide is sourced from PubChem (CID 45110664), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).