About N-propyl-3,6-diazabicyclo[3.2.2]nonane-3-carboxamide
N-propyl-3,6-diazabicyclo[3.2.2]nonane-3-carboxamide (PubChem CID 45110795) has the molecular formula C11H21N3O
and a molecular weight of 211.31 g/mol. Its IUPAC name is N-propyl-3,6-diazabicyclo[3.2.2]nonane-3-carboxamide.
Molecular Properties
| Compound Name | N-propyl-3,6-diazabicyclo[3.2.2]nonane-3-carboxamide |
| PubChem CID | 45110795 |
| Molecular Formula | C11H21N3O |
| Molecular Weight | 211.31 g/mol |
| Exact Mass | 211.17 |
| IUPAC Name | N-propyl-3,6-diazabicyclo[3.2.2]nonane-3-carboxamide |
| SMILES | CCCNC(=O)N1CC2CCC(C1)NC2 |
| InChI | InChI=1S/C11H21N3O/c1-2-5-12-11(15)14-7-9-3-4-10(8-14)13-6-9/h9-10,13H,2-8H2,1H3,(H,12,15) |
| InChIKey | RGALHTFZILSRBQ-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.31 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-propyl-3,6-diazabicyclo[3.2.2]nonane-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-propyl-3,6-diazabicyclo[3.2.2]nonane-3-carboxamide?
The IUPAC name of N-propyl-3,6-diazabicyclo[3.2.2]nonane-3-carboxamide (CID 45110795) is N-propyl-3,6-diazabicyclo[3.2.2]nonane-3-carboxamide.
What is the SMILES notation for N-propyl-3,6-diazabicyclo[3.2.2]nonane-3-carboxamide?
The canonical SMILES for N-propyl-3,6-diazabicyclo[3.2.2]nonane-3-carboxamide is CCCNC(=O)N1CC2CCC(C1)NC2.
What is the InChIKey of N-propyl-3,6-diazabicyclo[3.2.2]nonane-3-carboxamide?
The InChIKey is RGALHTFZILSRBQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21N3O/c1-2-5-12-11(15)14-7-9-3-4-10(8-14)13-6-9/h9-10,13H,2-8H2,1H3,(H,12,15).
What are the key properties of N-propyl-3,6-diazabicyclo[3.2.2]nonane-3-carboxamide?
N-propyl-3,6-diazabicyclo[3.2.2]nonane-3-carboxamide has a molecular weight of 211.31 g/mol, XLogP of 0.79, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-propyl-3,6-diazabicyclo[3.2.2]nonane-3-carboxamide is sourced from PubChem (CID 45110795), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).