About [(1S)-3,6-diazabicyclo[3.2.2]nonan-6-yl]-[(2R)-2-fluorocyclopropyl]methanone
[(1S)-3,6-diazabicyclo[3.2.2]nonan-6-yl]-[(2R)-2-fluorocyclopropyl]methanone (PubChem CID 45111238) has the molecular formula C11H17FN2O
and a molecular weight of 212.27 g/mol. Its IUPAC name is [(1S)-3,6-diazabicyclo[3.2.2]nonan-6-yl]-[(2R)-2-fluorocyclopropyl]methanone.
Molecular Properties
| Compound Name | [(1S)-3,6-diazabicyclo[3.2.2]nonan-6-yl]-[(2R)-2-fluorocyclopropyl]methanone |
| PubChem CID | 45111238 |
| Molecular Formula | C11H17FN2O |
| Molecular Weight | 212.27 g/mol |
| Exact Mass | 212.13 |
| IUPAC Name | [(1S)-3,6-diazabicyclo[3.2.2]nonan-6-yl]-[(2R)-2-fluorocyclopropyl]methanone |
| SMILES | O=C(C1C[C@H]1F)N1C[C@H]2CCC1CNC2 |
| InChI | InChI=1S/C11H17FN2O/c12-10-3-9(10)11(15)14-6-7-1-2-8(14)5-13-4-7/h7-10,13H,1-6H2/t7-,8?,9?,10+/m0/s1 |
| InChIKey | DLEXSPAHOKTEJT-AUXWQGHOSA-N |
| XLogP | 0.55 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.27 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [(1S)-3,6-diazabicyclo[3.2.2]nonan-6-yl]-[(2R)-2-fluorocyclopropyl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1S)-3,6-diazabicyclo[3.2.2]nonan-6-yl]-[(2R)-2-fluorocyclopropyl]methanone?
The IUPAC name of [(1S)-3,6-diazabicyclo[3.2.2]nonan-6-yl]-[(2R)-2-fluorocyclopropyl]methanone (CID 45111238) is [(1S)-3,6-diazabicyclo[3.2.2]nonan-6-yl]-[(2R)-2-fluorocyclopropyl]methanone.
What is the SMILES notation for [(1S)-3,6-diazabicyclo[3.2.2]nonan-6-yl]-[(2R)-2-fluorocyclopropyl]methanone?
The canonical SMILES for [(1S)-3,6-diazabicyclo[3.2.2]nonan-6-yl]-[(2R)-2-fluorocyclopropyl]methanone is O=C(C1C[C@H]1F)N1C[C@H]2CCC1CNC2.
What is the InChIKey of [(1S)-3,6-diazabicyclo[3.2.2]nonan-6-yl]-[(2R)-2-fluorocyclopropyl]methanone?
The InChIKey is DLEXSPAHOKTEJT-AUXWQGHOSA-N. The full InChI is InChI=1S/C11H17FN2O/c12-10-3-9(10)11(15)14-6-7-1-2-8(14)5-13-4-7/h7-10,13H,1-6H2/t7-,8?,9?,10+/m0/s1.
What are the key properties of [(1S)-3,6-diazabicyclo[3.2.2]nonan-6-yl]-[(2R)-2-fluorocyclopropyl]methanone?
[(1S)-3,6-diazabicyclo[3.2.2]nonan-6-yl]-[(2R)-2-fluorocyclopropyl]methanone has a molecular weight of 212.27 g/mol, XLogP of 0.55, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(1S)-3,6-diazabicyclo[3.2.2]nonan-6-yl]-[(2R)-2-fluorocyclopropyl]methanone is sourced from PubChem (CID 45111238), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).