C24H27F3N6O2S — CID 45111423
N-(3-butyl-5-tert-butyl-1,3,4-thiadiazol-2-ylidene)-2-[2-(pyridine-3-carbonyl)hydrazinyl]-5-(trifluoromethyl)benzamide (PubChem CID 45111423) has the molecular formula C24H27F3N6O2S and a molecular weight of 520.58 g/mol. Its IUPAC name is N-(3-butyl-5-tert-butyl-1,3,4-thiadiazol-2-ylidene)-2-[2-(pyridine-3-carbonyl)hydrazinyl]-5-(trifluoromethyl)benzamide.
| Compound Name | N-(3-butyl-5-tert-butyl-1,3,4-thiadiazol-2-ylidene)-2-[2-(pyridine-3-carbonyl)hydrazinyl]-5-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 45111423 |
| Molecular Formula | C24H27F3N6O2S |
| Molecular Weight | 520.58 g/mol |
| Exact Mass | 520.19 |
| IUPAC Name | N-(3-butyl-5-tert-butyl-1,3,4-thiadiazol-2-ylidene)-2-[2-(pyridine-3-carbonyl)hydrazinyl]-5-(trifluoromethyl)benzamide |
| SMILES | CCCCn1nc(C(C)(C)C)s/c1=N/C(=O)c1cc(C(F)(F)F)ccc1NNC(=O)c1cccnc1 |
| InChI | InChI=1S/C24H27F3N6O2S/c1-5-6-12-33-22(36-21(32-33)23(2,3)4)29-20(35)17-13-16(24(25,26)27)9-10-18(17)30-31-19(34)15-8-7-11-28-14-15/h7-11,13-14,30H,5-6,12H2,1-4H3,(H,31,34)/b29-22+ |
| InChIKey | CJTXTSJVIZMWLJ-QUPMIFSKSA-N |
| XLogP | 4.95 |
| TPSA | 101.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.58 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|