C23H29F3N4O2S — CID 45111571
N-(3-butyl-5-tert-butyl-1,3,4-thiadiazol-2-ylidene)-2-(cyclopentylideneamino)oxy-5-(trifluoromethyl)benzamide (PubChem CID 45111571) has the molecular formula C23H29F3N4O2S and a molecular weight of 482.57 g/mol. Its IUPAC name is N-(3-butyl-5-tert-butyl-1,3,4-thiadiazol-2-ylidene)-2-(cyclopentylideneamino)oxy-5-(trifluoromethyl)benzamide.
| Compound Name | N-(3-butyl-5-tert-butyl-1,3,4-thiadiazol-2-ylidene)-2-(cyclopentylideneamino)oxy-5-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 45111571 |
| Molecular Formula | C23H29F3N4O2S |
| Molecular Weight | 482.57 g/mol |
| Exact Mass | 482.20 |
| IUPAC Name | N-(3-butyl-5-tert-butyl-1,3,4-thiadiazol-2-ylidene)-2-(cyclopentylideneamino)oxy-5-(trifluoromethyl)benzamide |
| SMILES | CCCCn1nc(C(C)(C)C)s/c1=N\C(=O)c1cc(C(F)(F)F)ccc1ON=C1CCCC1 |
| InChI | InChI=1S/C23H29F3N4O2S/c1-5-6-13-30-21(33-20(28-30)22(2,3)4)27-19(31)17-14-15(23(24,25)26)11-12-18(17)32-29-16-9-7-8-10-16/h11-12,14H,5-10,13H2,1-4H3/b27-21- |
| InChIKey | YTJDAIQCAXLGKR-MEFGMAGPSA-N |
| XLogP | 6.11 |
| TPSA | 68.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.57 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|